法律人 LawPlayer logo

資料由法律人 LawPlayer整理提供·Pháp luật Việt Nam / LawPlayer, từ vbpl.vn (Bộ Tư pháp)

nghi-dinh

Quy định các danh mục chất ma túy và tiền chất

Số hiệu
28/2026/NĐ-CP
Ngày ban hành
19 tháng 1, 2026
Số điều
4
Điều Lời mở đầu

CHÍNH PHỦ | CỘNG HÒA XÃ HỘI CHỦ NGHĨA VIỆT NAM Độc lập - Tự do - Hạnh phúc

Số: 28/2026/NĐ-CP | Hà Nội, ngày 19 tháng 01 năm 2026

NGHỊ ĐỊNH

QUY ĐỊNH CÁC DANH MỤC CHẤT MA TÚY VÀ TIỀN CHẤT

Căn cứ Luật Tổ chức Chính phủ số 63/2025/QH15;

Căn cứ Luật Phòng, chống ma túy số 73/2021/QH14;

Căn cứ Bộ luật Hình sự số 100/2015/QH13 được sửa đổi, bổ sung bởi Luật số 12/2017/QH14 và Luật số 86/2025/QH15;

Căn cứ Luật Hóa chất số 69/2025/QH15;

Căn cứ Luật Dược số 105/2016/QH13 được sửa đổi, bổ sung bởi Luật số 44/2024/QH15;

Theo đề nghị của Bộ trưởng Bộ Công an;

Chính phủ ban hành Nghị định quy định các danh mục chất ma túy và tiền chất.

Điều 1Danh mục chất ma túy và tiền chất

Điều 1. Danh mục chất ma túy và tiền chất

Ban hành kèm theo Nghị định này Phụ lục các danh mục chất ma túy và tiền chất sau đây:

Danh mục I: Các chất ma túy tuyệt đối cấm sử dụng trong y học và đời sống xã hội; việc sử dụng các chất này trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh theo quy định đặc biệt của cơ quan có thẩm quyền:

IA. Các chất gây nghiện và muối, đồng phân, ester, ether và muối của các đồng phân, ester, ether có thể tồn tại của các chất sau (trừ khi ester, ether của chất đó nằm trong danh mục khác);

IB. Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau.

Danh mục II: Các chất ma túy được sử dụng hạn chế trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh hoặc trong lĩnh vực y tế theo quy định của cơ quan có thẩm quyền:

IIA. Các chất gây nghiện và muối, đồng phân, ester, ether, muối của các đồng phân, ester, ether có thể tồn tại của các chất sau (trừ khi ester, ether của chất đó nằm trong danh mục khác);

IIB. Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau.

Danh mục III: Các chất ma túy được sử dụng trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh hoặc trong lĩnh vực y tế, thú y theo quy định của cơ quan có thẩm quyền:

Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau.

Danh mục IV: Các tiền chất:

IVA: Các tiền chất thiết yếu, tham gia vào cấu trúc chất ma túy, không có ứng dụng hợp pháp trong y học và đời sống xã hội, được sử dụng hạn chế trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh theo quy định đặc biệt của cơ quan có thẩm quyền;

IVB: Các tiền chất thiết yếu, tham gia vào cấu trúc chất ma túy, có ứng dụng hợp pháp trong y học và đời sống xã hội;

IVC: Các tiền chất là hóa chất, dung môi, chất xúc tác dùng trong quá trình sản xuất chất ma túy.

Điều 2Trách nhiệm quản lý

Điều 2. Trách nhiệm quản lý

1. Bộ Công an có trách nhiệm quản lý nhà nước các chất ma túy, tiền chất phục vụ nghiên cứu, kiểm nghiệm, giám định (trừ các chất ma túy, tiền chất được sử dụng trong lĩnh vực y tế, nông nghiệp và môi trường thuộc phạm vi quản lý của Bộ Y tế, Bộ Nông nghiệp và Môi trường; các tiền chất được sử dụng trong lĩnh vực công nghiệp, quốc phòng thuộc phạm vi quản lý của Bộ Công Thương, Bộ Quốc phòng) và vì mục đích quốc phòng, an ninh.

2. Bộ Công Thương có trách nhiệm quản lý nhà nước về các tiền chất sử dụng trong lĩnh vực công nghiệp.

3. Bộ Y tế có trách nhiệm ban hành danh mục và quản lý nhà nước về các chất ma túy, tiền chất được sử dụng trong lĩnh vực y tế.

4. Bộ Nông nghiệp và Môi trường có trách nhiệm ban hành danh mục và quản lý nhà nước các chất ma túy, tiền chất được sử dụng trong lĩnh vực nông nghiệp và môi trường.

5. Bộ Quốc phòng có trách nhiệm quản lý nhà nước về các tiền chất được sử dụng trong lĩnh vực quốc phòng.

Điều 3Hiệu lực thi hành và tổ chức thực hiện

Điều 3. Hiệu lực thi hành và tổ chức thực hiện

1. Nghị định này có hiệu lực thi hành từ ngày 19 tháng 01 năm 2026.

2. Nghị định số 57/2022/NĐ-CP ngày 25 tháng 8 năm 2022 của Chính phủ quy định các danh mục chất ma túy và tiền chất; Nghị định số 90/2024/NĐ-CP ngày 17 tháng 7 năm 2024 sửa đổi, bổ sung danh mục chất ma túy và tiền chất ban hành kèm theo Nghị định số 57/2022/NĐ-CP ngày 25 tháng 8 năm 2022 của Chính phủ quy định các danh mục chất ma túy và tiền chất hết hiệu lực kể từ ngày Nghị định này có hiệu lực thi hành.

3. Các tổ chức, cá nhân sản xuất, kinh doanh hợp pháp Carisoprodol, Etomidate thực hiện các quy định về quản lý chất ma túy theo Nghị định này và các văn bản có liên quan kể từ ngày 01 tháng 6 năm 2026.

4. Các tổ chức, cá nhân sản xuất, kinh doanh hợp pháp 1,4-Butanediol thực hiện các quy định về quản lý tiền chất theo Nghị định này và các văn bản có liên quan trước ngày 31 tháng 12 năm 2026.

5. Bộ trưởng Bộ Công an, các Bộ trưởng, Thủ trưởng cơ quan ngang bộ, Thủ trưởng cơ quan thuộc Chính phủ, Chủ tịch Ủy ban nhân dân các tỉnh, thành phố trực thuộc trung ương và tổ chức, cá nhân có liên quan chịu trách nhiệm thi hành Nghị định này.

6. Khi phát hiện chất mới chưa có trong các danh mục chất ma túy và tiền chất ban hành kèm theo Nghị định này liên quan đến mục đích bất hợp pháp hoặc theo quy định tại ba Công ước của Liên hợp quốc về phòng, chống ma túy thì Bộ Công an có trách nhiệm chủ trì, phối hợp với Bộ Y tế, Bộ Công Thương, Bộ Khoa học và Công nghệ, Bộ Nông nghiệp và Môi trường, Bộ Quốc phòng và các cơ quan có liên quan xem xét, trình Chính phủ sửa đổi, bổ sung và công bố các danh mục đó./.

Nơi nhận: - Ban Bí thư Trung ương Đảng; - Thủ tướng, các Phó Thủ tướng Chính phủ; - Các bộ, cơ quan ngang bộ, cơ quan thuộc Chính phủ; - HĐND, UBND các tỉnh, thành phố trực thuộc trung ương; - Văn phòng Trung ương và các Ban của Đảng; - Văn phòng Tổng Bí thư; - Văn phòng Chủ tịch nước; - Hội đồng dân tộc và các Ủy ban của Quốc hội; - Văn phòng Quốc hội; - Tòa án nhân dân tối cao; - Viện kiểm sát nhân dân tối cao; - Kiểm toán nhà nước; - Ngân hàng Chính sách xã hội; - Ngân hàng Phát triển Việt Nam; - Ủy ban Trung ương Mặt trận Tổ quốc Việt Nam; - VPCP: BTCN, các PCN, Trợ lý TTg, TGĐ Cổng TTĐT, các Vụ, Cục, đơn vị trực thuộc, Công báo; - Lưu: VT, KGVX (2). | TM. CHÍNH PHỦ THỦ TƯỚNG Phạm Minh Chính

PHỤ LỤC

(Kèm theo Nghị định số 28/2026/NĐ-CP ngày 19 tháng 01 năm 2026 của Chính phủ)

| Danh mục I | Các chất ma túy tuyệt đối cấm sử dụng trong y học và đời sống xã hội; việc sử dụng các chất này trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh theo quy định đặc biệt của cơ quan có thẩm quyền |

|||

| Danh mục II | Các chất ma túy được sử dụng hạn chế trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh hoặc trong lĩnh vực y tế theo quy định của cơ quan có thẩm quyền |

| Danh mục III | Các chất ma túy được sử dụng trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh hoặc trong lĩnh vực y tế, thú y theo quy định của cơ quan có thẩm quyền |

| Danh mục IV | Các tiền chất |

DANH MỤC I

CÁC CHẤT MA TÚY TUYỆT ĐỐI CẤM SỬ DỤNG TRONG Y HỌC VÀ ĐỜI SỐNG XÃ HỘI; VIỆC SỬ DỤNG CÁC CHẤT NÀY TRONG NGHIÊN CỨU, KIỂM NGHIỆM, GIÁM ĐỊNH, VÌ MỤC ĐÍCH QUỐC PHÒNG, AN NINH THEO QUY ĐỊNH ĐẶC BIỆT CỦA CƠ QUAN CÓ THẨM QUYỀN

IA. Các chất gây nghiện và muối, đồng phân, ester, ether và muối của các đồng phân, ester, ether có thể tồn tại của các chất sau (trừ khi ester, ether của chất đó nằm trong danh mục khác):

| STT | Tên chất | Tên khoa học | Mã thông tin CAS |

|||||

| 1 | Acetorphine | 3- O -acetyltetrahydro - 7 - α - (1 - hydroxyl -1 - methylbutyl) - 6, 14 - endo etheno - oripavine | 25333-77-1 |

| 2 | Acetyl- alpha - methylfenanyl | N - [1 - ( α - methylphenethyl) - 4 - piperidyl] acetanilide | 101860-00-8 |

| 3 | Acetyl fentanyl | N -(1-Phenethylpiperidin-4-yl)- N- phenylacetamide | 3258-84-2 |

| 4 | Alphacetylmethadol | α -3-acetoxy-6-dimethylamino - 4,4 - diphenylheptane | 17199-58-5 |

| 5 | Alpha -methylfentanyl | N -[1-( α -methylphenethyl)-4-peperidyl] propionanilide | 79704-88-4 |

| 6 | Alphamethylthiofentanyl | N -[1-[1-methyl-2-(2-thienyl) ethyl]-4-piperidyl] propionanilide | 103963-66-2 |

| 7 | Beta -hydroxyfentanyl | N- [1-( β -hydroxyphenethyl)-4- peperidyl] propionanilide | 78995-10-5 |

| 8 | Beta -hydroxymethyl-3-fentanyl | N-[1-( β -hydroxyphenethyl)-3-methyl-4-piperidyl] propinonanilide | 78995-14-9 |

| 9 | Cầy cần sa | Lá, rễ, thân, cành, nụ, hoa, quả của cây cần sa | |

| 10 | Các chế phẩm từ cần sa | Nhựa cần sa và các hỗn hợp thu được từ cây cần sa có chứa tetrahydrocannabinol (THC) | |

| 11 | Carfentanil | Methyl 4-(N-propionyl-N-phenylanimo)-1 - (2- phenylethyl)-4-piperidinecarboxylate | 59708-52-0 |

| 12 | Desomorphine (dẫn xuất của morphine) | Dihydrodeoxymorphine | 427-00-9 |

| 13 | Etorphine | Tetrahydro- 7α -(1 - hydroxy -1 - methylbutyl)- 6,14- endoetheno- oripavine | 14521-96-1 |

| 14 | Heroin, Diacetylmorphine (dẫn xuất của morphine) | (5α,6α)-7,8-didehydro-4,5- epoxy-17- methyl morphinan-3,6-diol diacetate (ester) | 561-27-3 |

| 15 | Ketobemidone | 4 - meta - hydroxyphenyl -1 - methyl - 4 - propionylpiperidine | 469-79-4 |

| 16 | 3-methylfentanyl | N - (3 - methyl - 1 - phenethyl - 4 - piperidyl) propionanilide | 42045-86-3 |

| 17 | 3 -methylthiofentanyl | N - [3 - methyl -1 [2 - (2 - thienyl) ethyl] - 4 - piperidyl] propionanilide | 86052-04-2 |

| 18 | Morphine methobromide và các chất dẫn xuất của Morphine Nitơ hóa trị V khác | ( 5α,6α ) -17 - Methyl - 7,8 -didehydro - 4,5 - epoxymorphinan - 3,6 - diol - bromomethane (1:1) | 125-23-5 |

| 19 | MPPP | 1 -methyl-4-phenyl-4-piperidinol propionate (ester) | 13147-09-6 |

| 20 | Para -fluorofentanyl | 4’-fluoro- N- (1- phenethyl-4-piperidyl) propionanilide | 90736-23-5 |

| 21 | PEPAP | 1 - phenethyl - 4 - phenyl - 4- piperidinol acetate | 64-52-8 |

| 22 | Thiofentanyl | N - (1 [2- (2- thienyl) ethyl]- 4- piperidyl] - 4 - propionanilide | 1165-22-6 |

| 23 | Cây thuốc phiện/cây anh túc (opium poppy) | Lá, rễ, thân, cành, nụ, hoa, quả của cây thuốc phiện/cây anh túc | |

| 24 | Các chế phẩm từ thuốc phiện [1] | Nhựa thuốc phiện và các hỗn hợp thu được từ cây thuốc phiện/cây anh túc có chứa morphine và một/nhiều chất sau: codeine, narcotine, papaverine và thebaine | |

IB. Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau:

| STT | Tên chất | Tên khoa học | Mã thông tin CAS |

|||||

| 1 | Brolamphetamine, DOB | 2,5 - dimethoxy - 4 - bromoamphetamine | 64638-07-9 |

| 2 | Cathinone | (-)-(S)-aminopropiophenone | 71031-15-7 |

| 3 | DET | N, N - diethyltryptamine | 7558-72-7 |

| 4 | Delta-9-tetrahydrocanabinol và ester | (6 aR , 10 aR ) - 6 a , 7, 8, 10 a - tetrahydro - 6,6,9 - trimethyl - 3 - pentyl - 6 H - dibenzo [ b,d ] pyran - 1 - ol | 1972-08-3 |

| 5 | Delta-6a(10a)-THC và ester | 7,8,9,10-tetrahydro-6,6,9-trimethyl-3-pentyl-6H-dibenzo [b, d] pyran-1-ol | |

| 6 | Delta-6a(7)-THC và ester | (9R,10aR)-8,9,10,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-6H-dibenzo [b, d] pyran-1-ol | |

| 7 | Delta-7-THC và ester | (6aR,9R,10aR)-6a,9,10,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-6H-dibenzo [b, d] pyran-1-ol | |

| 8 | Delta-8-THC và ester | (6aR,10aR)-6a,7,10,10a-tetrahydro-6,6,9-trimethyl-3-pentyl-6H-dibenzo [b, d] pyran-1-ol | |

| 9 | Delta-10-THC và ester | 6a,7,8,9-tetrahydro-6,6,9-trimethyl-3-pentyl-6H-dibenzo [b, d] pyran-1-ol | |

| 10 | Delta-9(11)-THC và ester | (6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6,6-dimethyl-9-methylene3- pentyl-6H-dibenzo[b,d]pyran-1-ol | |

| 11 | DMA | (±) -2,5 -dimethoxy - α - methylphenylethylamine | 2801-68-5 |

| 12 | DMHP | 3 - (1,2 - dimethylheptyl) -1 - hydroxy - 7, 8, 9, 10 - tetrahydro - 6,6,9 - trimethyl - 6 H - dibenzo [ b,d ] pyran | 32904-22-6 |

| 13 | DMT | N, N - dimethyltryptamine | 61-50-7 |

| 14 | DOET | (±) - 4 - ethyl - 2,5 - dimethoxy - α - phenethylamine | 22004-32-6 |

| 15 | Eticyclidine | N - ethyl - 1 - phenylcylohexylamine | 2201-15-2 |

| 16 | Etryptamine | 3 - (2 - aminobuty) indole | 2235-90-7 |

| 17 | Lá Khat | Lá cây Catha edulis | Lá Khat |

| 18 | MDMA | (±) - N - α - dimethyl - 3,4 - (methylenedioxy) phenethylamine | 42542-10-9 |

| 19 | Mescalin | 3,4,5 - trimethoxyphenethylamine | 54-04-6 |

| 20 | Methcathinone | 2 - (methylamino)-1- phenylpropan-1- one | 5650-44-2 |

| 21 | 4-methylaminorex | (±) - cis - 2 - amino - 4 - methyl - 5 - phenyl - 2 - oxazoline | 3568-94-3 |

| 22 | MMDA | (±) - 5 - methoxy - 3,4 - methylenedioxy - α - methylphenylethylamine | 13674-05-0 |

| 23 | (+)-Lysergide; LSD | 9,10 - didehydro - N, N - diethyl - 6 - methylergoline - 8 β - carboxamide | 50-37-3 |

| 24 | N -hydroxy MDA; MDOH | (±) - N - hydroxy - [ α - methyl - 3,4 - (methylenedyoxy) phenethyl] hydroxylamine | 74698-47-8 |

| 25 | N -ethyl MDA | (±) N - ethyl - methyl - 3,4 - (methylenedioxy) phenethylamine | 82801-81-8 |

| 26 | Parahexyl | 3 - hexyl - 7, 8, 9, 10 - tetrahydro - 6, 6, 9 - trimethyl - 6 H - dibenzo [ b,d ] pyran -1- ol | 117-51-1 |

| 27 | PMA | p - methoxy - α - methylphenethylamine | 64-13-1 |

| 28 | Psilocine; Psilotsin | 3-[2-(dimethylamino) ethyl] indol-4-ol | 520-53-6 |

| 29 | Psilocybine | 3 -[2-dimethylaminoethyl] indol -4- yl dihydrogen phosphate | 520-52-5 |

| 30 | Rolicyclidine | 1-(1-phenylcyclohexy) pyrrolidine | 2201-39-0 |

| 31 | STP; DOM | 2,5-dimethoxy-4, α - dimethylphenethylamine | 15588-95-1 |

| 32 | Tenamfetamine; MDA | α - methyl - 3,4 - (methylendioxy) phenethylamine | 4764-17-4 |

| 33 | Tenocyclidine; TCP | 1-[1-(2-thienyl) cyclohexyl] piperidine | 21500-98-1 |

| 34 | TMA | (±) - 3,4,5- trimethoxy- α - methylphenylethylamine | 1082-88-8 |

DANH MỤC II

CÁC CHẤT MA TÚY ĐƯỢC SỬ DỤNG HẠN CHẾ TRONG NGHIÊN CỨU, KIỂM NGHIỆM, GIÁM ĐỊNH, VÌ MỤC ĐÍCH QUỐC PHÒNG, AN NINH HOẶC TRONG LĨNH VỰC Y TẾ THEO QUY ĐỊNH CỦA CƠ QUAN CÓ THẨM QUYỀN

IIA. Các chất gây nghiện và muối, đồng phân, ester, ether, muối của các đồng phân, ester, ether có thể tồn tại của các chất sau (trừ khi ester, ether của chất đó nằm trong danh mục khác):

| STT | Tên chất | Tên khoa học | Mã thông tin CAS |

|||||

| 1 | 2-Methyl-AP-237 | 1-[2-Methyl-4-(3-phenyl-2-propen-1-yl)-1-piperazinyl]-1-butanone | 98608-59-4 |

| 2 | 4-fluoroisobutyrfentanyl; Para-Fluoroisobutyrfentanyl; 4-HBF;pFIBF | N-(4-fluorophenyl)-N-(1-phenethylpiperidin-4-yl) isobutyramide | 244195-32-2 |

| 3 | Acetyldihydrocodeine [dẫn xuất của codeine) | (5α, 6α)- 4,5- epoxy-3-methoxy-17-methyl- morphinan-6-ol acetate | 3861-72-1 |

| 4 | Acetylmethadol | 3 - acetoxy - 6 - dimethylamino - 4,4 - diphenylheptane | 509-74-0 |

| 5 | Acryloylfentanyl; Acrylfentanyl | N-(1-phenylethylpiperidin-4-yl)-N-phenylacrylamide | 82003-75-6 |

| 6 | AH-7921 | 3,4- dichloro- N - [[1- (dimethylamino) xyclohexyl] methyl] - benzamide | 55154-30-8 |

| 7 | Alfentanil | N - [1 - [2 - (4 - ethyl - 4,5 - dihydro - 5 -oxo -1 H - tetrazol - 1 - yl) ethyl] - 4 - (methoxymethyl) - 4 - piperidinyl] - N - phenylpropanamide | 71195-58-9 |

| 8 | Allylprodine | 3 -allyl -1-methyl - 4- phenyl- 4- propionoxypiperidine | 25384-17-2 |

| 9 | Alphameprodine | α - 3 - ethyl - 1 - methyl - 4 - phenyl - 4 - ptopionoxypiperidine | 468-51-9 |

| 10 | Alphamethadol | α - 6- dimethylamino - 4,4 - diphenyl - 3 - heptanol | 17199-54-1 |

| 11 | Alphaprodine | ( α -1,3 - dimethyl - 4 - phenyl - 4 - propionoxypiperidine | 77-20-3 |

| 12 | Anileridine | 1 - para - aminophenethyl - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 144-14-9 |

| 13 | Benzenthidine | 1 - (2 - benzyloxyethyl) - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 3691-78-9 |

| 14 | Benzylmorphine; 3-benzylmorphine | (5α,6α)-7,8-didehydro-4,5-epoxy-17-methyl-3- (phenylmethoxy) morphinan-6-ol | 14297-87-1 |

| 15 | Betacetylmethadol | β - 3 - acetoxy - 6 - dimethylamino - 4,4 - diphenylheptane | 17199-59-6 |

| 16 | Betameprodine | β - 3 - ethyl - 1 - methyl - 4 - phenyl - propionoxypiperidine | 468-50-8 |

| 17 | Betamethadol | β - 6- dimethylamino - 4,4 - diphenyl - 3 - hepthanol | 17199-55-2 |

| 18 | Betaprodine | β - 13 - dimethyl - 4- phenyl - 4- propioroxypiperidine | 468-59-7 |

| 19 | Bezitramide | 1 - (3 - cyano - 3,3 - diphenylpropyl) - 4 - (2 - oxo - 3 - propionyl -1 - benzimidazolinyl) - piperidine | 15301-48-1 |

| 20 | Brorphine | 1-(1-(1-(4-bromophenyl) ethyl) piperidin-4-yl)-1,3-dihydro-2H-benzo[d]imidazol-2-one | 2244737-98-0 |

| 21 | Butorphanol | (-) -17-(cyclobutylmethyl) morphinan-3,14 diol | 42408-82-2 |

| 22 | Butonitazene | 2-(2-(4-butoxybenzyl)-5-nitro-1H- benzo[d]imidazol-1-yl)-N,N-diethylethan-1-amine | 95810-54-1 |

| 23 | Butyrfentanyl | N -(1-phenethylpiperidin-4-yl)- N -phenylbutyramide | 1169-70-6 |

| 24 | Clonitrazene | (2 - para - chlobenzyl)-1 - diethylaminoethyl - 5 - nitrobenzimidazole | 3861-76-51 |

| 25 | Crotonylfentanyl | (E)-N-(1-phenethylpiperidin-4-yl)-N-phenylbut-2-enamide | 760930-59-4 |

| 26 | Cocaine | Benzoylecgonine, methylester | 50-36-2 |

| 27 | Codeine; 3-methylmorphine (dẫn xuất của morphine) | (5α,6α)-7,8-didehydro-4,5- epoxy-3- methoxy-17- methylmorphinan-6-ol | 76-57-3 |

| 28 | Codoxime | Dihydrocodeinone - 6 - carboxymethyloxime | 7125-76-0 |

| 29 | Cyclopropylfentanyl | N-(1-phenethylpiperidin-4-yl)- N-phenylcyclopropane carboxamide | 1169-68-2 |

| 30 | Ciramadol | (-) - 2 -(α -Dimethylamino - 3 -hydroxybenzyl) cyclohexanol | 63269-31-8 |

| 31 | Dezocine | (-)-13β-Amino- 5,6,7,8,9,10,11α, 12 octahydro- 5α- methyl-5,11-methanobenzo-cyclodecen-3- ol | 53648-55-8 |

| 32 | Dextromoramide | (+) - 4 [2 - methyl - 4 - oxo - 3,3 - diphenyl - 4- (1 - pyrrolidinyl) butyl] morpholine | 357-56-2 |

| 33 | Dextropropoxyphene | α - (+) - 4 - dimethylamino -1,2 - diphenyl - 3 - methyl - 2 - butanol propionate | 469-62-5 |

| 34 | Diampromide | N - [2 - (methylphenethylamino) - propyl] propionalinide | 552-25-0 |

| 35 | Diethylthiambutene | 3 - diethylamino -1,1 - di - (2’ -thienyl) -1 - butene | 86-14-6 |

| 36 | Difenoxin | 1 - (3 - cyano - 3,3 - diphenylpropyl) - 4 - phenylisonipecotic acid | 28782-42-5 |

| 37 | Dihydrocodeine (dẫn xuất của morphine) | 4,5α-epoxy-3-methoxy-17- methylmorphinan-6α-ol | 125-28-0 |

| 38 | Dihydroetorphine (dẫn xuất của etorphine) | 7,8-dihydro-7α-[1-(R)-hydroxy-1-methylbutyl]-6,14-endoethanotetrahydrooripavine | 14357-76-7 |

| 39 | Dihydromorphine | 7,8 - dihydromorphine | 509-60-4 |

| 40 | Dimenoxadol | 2- dimethylaminoethyl- 1 - ethoxy - 1,1 - diphenylacetate | 509-78-4 |

| 41 | Dimepheptanol | 6 - dimethylamino - 4,4 - diphenyl - 3 - hepthanol | 545-90-4 |

| 42 | Dimethylthiambutene | 3 - dimethylamino -1,1 - di - (2’- thienyl) -1- butene | 524-84-5 |

| 43 | Dioxaphetyl butyrate | Ethyl- 4 - morpholino - 2,2 - diphenylbutyrate | 467-86-7 |

| 44 | Diphenoxylate | 1- (3- cyano - 3,3 - diphenylpropyl) - 4 - phenylpiperidine- 4 - carboxylic acid ethyl ester | 915-30-0 |

| 45 | Dipipanone | 4,4 - diphenyl - 6 - piperidine - 3 - heptanone | 467-83-4 |

| 46 | Drotebanol | 3,4 - dimethoxy -17 methylmorphinan - 6 β , 14 - diol | 3176-03-2 |

| 47 | Ecgonine và ester | 3 -hydroxy-2-tropane carboxylic acid | 481-37-8 |

| 48 | Ethylmethylthiambutene | 3 - ethylmethylamino -1,1- di - (2’- thienyl) -1- butene | 441-61-2 |

| 49 | Ethylmorphine (dẫn xuất của morphine) | 3 - Ethylmorphine | 76-58-4 |

| 50 | Etazene | 2-[(4-Ethoxyphenyl) methyl]-N,N-diethyl-1H-benzimidazole-1-ethanamine | 14030-76-3 |

| 51 | Etonitazene | 1 - diethylaminoethyl - 2 para - ethoxybenzyl - 5 - nitrobenzimidazole | 911-65-9 |

| 52 | Etonitazepipne | 2-[(4-ethoxyphenyl) methyl]-5-nitro-1-[2-(1-piperidinyl)ethyl]-1H-benzimidazole | |

| 53 | Etonitazepyne | 2-[(4-Ethoxyphenyl) methyl]-5-nitro-1-(2-pyrrolidin-1-ylethyl)-1H-benzoimidazole | 2785346-75-8 |

| 54 | Etoxeridine | 1 - [2 - (2 - hydroxyethoxy) - ethyl] - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 469-82-9 |

| 55 | Fentanyl | 1 - phenethyl - 4 - N - propionylanilinopiperidine | 437-38-7 |

| 56 | Furanylfentanyl | N -Phenyl- N -[1-(2-phenylethyl)piperidin- 4- yl]furan-2-carboxamide | 101345-66-8 |

| 57 | Furethidine | 1 - (2 - tetrahydrofurfuryloxyethyl) - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 2385-81-1 |

| 58 | Hydrocodone | Dihydrocodeinone | 125-29-1 |

| 59 | Hydromorphinol | 14 - hydroxydihydromorphine | 2183-56-4 |

| 60 | Hydromorphone | Dihydromorphinone | 466-99-9 |

| 61 | Hydroxypethidine | 4 - meta - hydioxyphenyl -1 - methylpiperidine - 4 - carboxylic acid ethyl ester | 468-56-4 |

| 62 | Isomethadone | 6 - dimelhylamino - 5 - methyl - 4,4 - diphenyl - 3 - hexanone | 466-40-0 |

| 63 | Isotonitazene | N,N-diethyl-2-(2-(4-isopropoxybenzyl)-5-nitro-1H-benzo[d]imidazol-1-yl)ethan-1-amine | 14188-81-9 |

| 64 | Lá Coca | | |

| 65 | Levomethadone | (3- Heptanone, 6- (dimethylamino)-4,4-Diphenyl, (R) | 125-58-6 |

| 66 | Levomethorphan [2] | (-) - 3 - methoxy - N - methylmorphinan | 125-70-2 |

| 67 | Levomoramide | (-) - 4 - [2 - methyl - 4 - oxo - 3,3 - diphenyl - 4 - (1 - pyrrolidinyl) butyl] morpholine | 5666-11-5 |

| 68 | Levophenacylmorphan | (-) - 3 - hydroxy - N - phenacylmorphinan | 10061-32-2 |

| 69 | Levorphanol [2] | (-) - 3 - hydroxy - N - methylmorphinan | 77-07-6 |

| 70 | Meptazinol | (3(3- Ethyl-1- methylperhydroazepin-3- yl) phenol | 54340-58-8 |

| 71 | Metazocine | 2’ - hydroxy - 2,5,9 - trimethyl - 6,7 - benzomorphan | 3734-52-9 |

| 72 | Methadone a | 6 - dimethylamino - 4,4 - diphenyl - 3 - heptanone | 76-99-3 |

| 73 | Methadone intermediate | 4 - cyano - 2 dimethylamino - 4,4 - diphenylbutane | 125-79-1 |

| 74 | Methyldesorphine (dẫn xuất của morphine) | 6 - methyl - delta 6 - deoxymorphine | 16008-36-9 |

| 75 | Methyldihydromorphine (dẫn xuất của morphine) | 6 - methyldihydromorphine | 509-56-8 |

| 76 | Metopon (dẫn xuất của morphine) | 5 - methyldihydromorphinone | 143-52-2 |

| 77 | Methoxyacetylfentanyl | 2-methoxy-N-(1-phenethylpiperidin-4-yl)-N- phenylacetamide | 101345-67-9 |

| 78 | Metonitazene | N,N-diethyl-2-(2-(4-methoxybenzyl)-5-nitro-1H-benzo[d]imidazol-1-yl)ethan-1-amine | 14680-51-4 |

| 79 | Moramide intermediate | 2 - methyl - 3 - morpholino -1,1 - diphenylpropane carboxylic acid | 3626-55-9 |

| 80 | Morpheridine | 1 - (2 - morpholinoethyl)- 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 469-81-8 |

| 81 | Morphine | (5α,6α)-7,8-didehydro-4,5- epoxy-17- methylmorphinan-3,6-diol | 57-27-2 |

| 82 | Morphine - N - oxide (dẫn xuất của morphine) | (5α,6α)-7,8-didehydro-4,5- epoxy-17 methylmorphinan-3,6-diol-17- oxide | 639-46-3 |

| 83 | MT-45 | 1-xyclohexyl-4 (1,2-diphenylethyl) piperazine | 41537-67-1 |

| 84 | Myrophine (dẫn xuất của morphine) | Myristylbenzylmorphine | 467-18-5 |

| 85 | Nalbuphine | 17- Cyclobutylmethyl- 7,8- dihydro- 14- hydroxy- 17-normorphine | 20594-83-6 |

| 86 | N-desethyl isotonitazene; Norisotonitazene | N-ethyl-2-(2-(4-isopropoxybenzyl)-5-nitro- 1H- benzo[dlimidazol-1-yl)ethan-1-amine | |

| 87 | Nicocodine (dẫn xuất của morphine) | 6 - nicotinylcodeine | 3688-66-2 |

| 88 | Nicodicodine (dẫn xuất của morphine) | 6 - nicotinyldihydrocodeine | 808-24-2 |

| 89 | Nicomorphine | 3,6 - dinicotinylmorphine | 639-48-5 |

| 90 | Noracymethadol | (±) - α - 3 - acetoxy - 6 - methylamino - 4,4 - diphenyl - heptane | 1477-39-0 |

| 91 | Norcodeine (dẫn xuất của morphine) | N - demethylcodeine | 467-15-2 |

| 92 | Norievorphanol | (-) - 3 - hydroxymorphinan | 1531-12-0 |

| 93 | Normethadone | 6 - dimethylamino - 4,4 diphenyl - 3 - hexanone | 467-85-6 |

| 94 | Normorphine | N - demethylmorphine | 466-97-7 |

| 95 | Norpipanone | 4,4 - diphenyl - 6 - piperidino - 3 - hexanone | 561-48-8 |

| 96 | N-Desethyl etonitazene | 2-(2-(4-ethoxybenzyl)-5-nitro-1H-benzo[d]imidazol-1-yl)-N-ethylethan-1-amine | 2732926-26-8 |

| 97 | N-pyrrolidino isotonitazene; Isotonitazepyne | 2-(4-isopropoxybenzyl)-5-nitro-1-(2-(pyrrolidin-1-yl)ethyl)-1H-benzo[d]imidazole | 3053113-12-2 |

| 98 | N-pyrrolidino protonitazene; Protonitazepyne | 5-nitro-2-(4-propoxybenzyl)-1-(2-(pyrrolidin-1-yl) ethyl)-1H-benzo[d]imidazole | |

| 99 | N-pyrrolidino metonitazene | 2-(4-methoxybenzyl)-5-nitro-1-(2-(pyxrolidin-1-yl) ethyl)-1H-benzo[d]imidazole | |

| 100 | Ocfentanil | N-(2-fluorophenyl)-2-methoxy-N-(1-phenethylpiperidin-4-yl) acetamide | 101343-69-5 |

| 101 | Oripavine | 3-O-demethylthebaine | 467-04-9 |

| 102 | Orthofluorofentanyl; 2- Fluorofentanyl | N-(2-fluorophenyl)-N-(1-phenethylpiperidin-4-yl) propionamide | 910616-29-4 |

| 103 | Oxycodone | 14 - hydroxydihydrocodeinone | 76-42-6 |

| 104 | Oxymorphone | 14 - hydroxydihydromorphinone | 76-41-5 |

| 105 | Parafluorobutyrylfentanyl; 4-Fluorobutyrfentanyl | N-(4-fluorophenyl)-N-(1-phenethyl piperidin-4-yl)butyramide | 244195-31-1 |

| 106 | Pethidine | 1 - methyl - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 57-42-1 |

| 107 | Pethidine intermediate A | 4 - cyano -1 - methyl - 4 - phenylpiperidine | 3627-62-1 |

| 108 | Pethidine intermediate B | 4 - Phenylpiperidine - 4 - carboxylic acid ethyl ester | 77-17-8 |

| 109 | Pethidine intermediate C | 1 - methyl -4- phenylpiperidine -4- carboxylic add | 3627-48-3 |

| 110 | Phenadoxone | 6 - morpholino - 4,4 - diphenyl - 3 - heptanone | 467-84-5 |

| 111 | Phenampromide | N -(1- methyl -2-piperidinoethyl) propionanilide | 129-83-9 |

| 112 | Phenazocine | 2’ - hydroxy - 5,9 - dimethyl - 2 - phenethyl - 6,7 - benzomorphan | 127-35-5 |

| 113 | Phenomorphan | 3 - hydroxy - N - phenethylmorphinan | 468-07-5 |

| 114 | Phenoperidine | 1 - (3 - hydroxy - 3 - phenylpropyl) - 4 - phenylpiperidine - 4 - carboxylic acid ethyl ester | 562-26-5 |

| 115 | Pholcodine (dẫn xuất của morphine) | 3 - morpholinylethylmorphine | 509-67-1 |

| 116 | Piminodine | 4 - phenyl - 1 - (3 - phenylaminopropyl) - piperidine - 4 - carboxylic acid ethyl ester | 13495-09-5 |

| 117 | Piritramide | 1- (3 - cyano - 33 - diphenylpropyl) - 4 - (1 - piperidino) - piperidine - 4 - carboxylic acid amide | 302-41-0 |

| 118 | Proheptazine | 1,3 -dimethyl - 4- phenyl - 4 - propionoxyazacycloheptane | 77-14-5 |

| 119 | Properidine | 1 - methyl - 4 - phenylpiperidine - 4 - carboxylic acid isopropyl ester | 561-76-2 |

| 120 | Propiram | N - (1 - methyl - 2 - piperidinoethyl) - N - 2 - pyridylpropionamide | 15686-91-6 |

| 121 | Protonitazene | N,N-Diethyl-5-nitro-2-[(4-propoxyphenyl) methyl]-1H-benzimidazole-1-ethanamine | 95958-84-2 |

| 122 | Racemethorphan [3] | (±) - 3 - methoxy - N - methylmorphinan | 510-53-2 |

| 123 | Racemoramide | (±) - 4 - [2 - methyl - 4 - oxo - 3,3 - diphenyl - 4 - (1 - pyrrolidinyl) butyl] morpholine | 545-59-5 |

| 124 | Racemorphan [3] | (±) - 3 - hydroxy - N - methylmorphinan | 297-90-5 |

| 125 | Remifentanil | 1 - (2 - methoxycarbonylethyl) - 4 - (phenylpropionylamino)-piperidine - 4carboxylic add methyl ester | 132875-61-7 |

| 126 | Sufentanil | N - [4 - (methoxymethyl) -1- [2- (2 - thienyl) - ethyl] - 4 - piperidyl] propionanilide | 56030-54-7 |

| 127 | Tetrahydrofuranylfentanyl; THF-F | N-(1-phenethylpiperidin-4-yl)-N-phenyltetrahydrofuran-2-carboxamide | 2142571-01-3 |

| 128 | Thebacon; Acethyldihydrocodeinone | (4,5α-epoxy-3-methoxy-17- methylmorphin-6-en-6-yl) acetate | 466-90-0 |

| 129 | Thebaine | 4,5α-epoxy-3,6-dimethoxy-17- methylmorphina-6,8- dien | 115-37-7 |

| 130 | Tilidine | (±) - ethyl - trans - 2 - (dimethylamino) - 1 - phenyl - 3 - cyclohexene - 1 - carboxylate | 20380-58-9 |

| 131 | Tonazocine mesylate | (±)-1-[(2R*,6S*,11S*)- 1,2,3,4,5,6- hexahydro- 8- hydroxy- 3,6,11- trimethyl- 2,6- methano-3- Benzazocin-11- yl]-3-one- methanesulphonate | 73789-00-1 |

| 132 | Tramadol | (±)-Trans-2-Dimethylaminomethyl-1-(3-methoxyphenyl) cyclohexan-1-ol | 27203-92-5 |

| 133 | Trimeperidine | 1,2,5 - trimethyl - 4 - phenyl - 4 - propionoxypiperidine | 64-39-1 |

| 134 | U-47700 | 3,4-dichloro- N -[(1R,2R)-2 -(dimethylamino) cyclohexyl]- N - methyl-benzamide | 121348-98-9 |

| 135 | Valerylfentanyl | N-(1-phenethylpiperidin-4-yl)-N-phenylpentanamid | 122882-90-0 |

IIB. Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau:

| STT | Tên chất | Tên khoa học | Mã thông tin CAS |

|||||

| 1 | (1-(5-fluoropentyl)-3-(2-ethylbenzoyl) indole) | (2-ethylphenyl) (1-(5-fluoropentyl)- 1 H - indol-3-yl) methanone | |

| 2 | (1-(5-fluoropentyl)-3-(2-methylbenzoyl) indole) | (1-(5-fluoropentyl)-1 H -indol-3-yl) (o-tolyl)methanone | |

| 3 | (1-Pentyl-1 H -indazol-3-yl) (2,2,3,3tetramethylcyclopropyl) methanone | (1-Pentyl-1 H -indazol-3-yl) (2,2,3,3- tetramethylcyclopropyl) methanone | |

| 4 | (1-pentyl-1 H -indazol-3-yl) piperazin-1-yl) methanone | (1-pentyl-1 H -indazol-3-yl) piperazin-1-yl) methanone | |

| 5 | (1-Pentyl-1 H -indol-3-yl) (pyridin-3-yl) methanone | (1-Pentyl-1 H -indol-3-yl) (pyridin-3-yl) methanone | |

| 6 | (1-pentyl-1 H -indol-3-yl) piperazin-1-yl) methanone | (1-pentyl-1 H -indol-3-yl) piperazin-1-yl) methanone | |

| 7 | 1-(Cyclohexylmethyl)-2-[(4-ethoxyphenyl) methyl]- N,N -diethyl-1 H -benzimidazol-5- carboxamide | 1-(cyclohexylmethyl)-2-(4-ethoxybenzyl)- N,N -diethyl-1 H -benzo[ d ]imidazole-5-carboxamide | 1046140-32-2 |

| 8 | 1-(Phenylmethyl)-1 H -indole-3-carboxylic acid 8-quinolinyl ester | quinolin-8-yl 1-benzyl-1 H -indole-3-carboxylate | |

| 9 | 1-Benzyl- N -(quinolin-8-y])-1 H -indazole-3-carboxamide | 1-benzyl- N -(quinolin-8-yl)-1 H -indazole-3-carboxamide | |

| 10 | 1-Benzyl- N -(quinolin-8-yl)-1 H -indole-3-carboxamide | 1-benzyl- N -(quinolin-8-yl)-1 H -indole-3-carboxamide | |

| 11 | 1-Pentyl-N-(quinolin-8-yl)-1H-indole-3-carboxamide | 1-pentyl- N -(quinolin-8-yl)-1 H -indole-3-carboxamide | |

| 12 | 1Cp-LSD | (6aR,9R)-4-(cyclopropanecarbonyl)-N,N-diethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide | |

| 13 | 2C-B | 4-Bromo-2,5-dimethoxyphenethylamine | 66142-81-2 |

| 14 | 2C-E | 4 - ethyl - 2,5 - Dimethoxyphenethylamine | 71539-34-9 |

| 15 | 2C-H | 2,5-dimethoxy-phenethylamine | 3600-86-0 |

| 16 | 2-fluorodeschloroketamine; Fluoroketamine | 2-(2-fluorophenyl)-2- (methylamino)cyclohexan-1-one | 111982-50-4 |

| 17 | 2-FMA | 2-fluoro-N-α-dimethyI-benzeneethanamine | |

| 18 | 3-(4-Hydroxymethylbenzoyl) -1- pentylindole | (4-(hydroxymethyl) phenyl)(1-pentyl-1H-indol-3-yl)methanone | |

| 19 | 3-(5-Benzyl-1,3,4-oxadiazol-2-yl)-1-(2-morpholin-4-ylethyl)-1H-indole | 4-(2-(3-(5-benzyl-1,3,4-oxadiazol-2-yl)-1 H -indol-1-yl) ethyl)morpholine | |

| 20 | 3-(5-Benzyl-1,3,4-oxadiazol-2-yl)-1-(2-pyrrolidin-1-ylethyl)-1H-indole | 2-benzyl-5-(1-(2-(pyrrolidin-1-yl) ethyl)-1 H -indol-3-yl)-1,3,4-oxadiazoIe | |

| 21 | 3-FEA | N-ethyl-3-fluoro-α-methyl- benzeneethanamine, monohydrochloride | 54982-43-3 |

| 22 | 3-CMG; Chloromethcathinone | 1-(3-chlorophenyl)-2-(methylamino) propan-1-one | 1049677-59-9 |

| 23 | 3-MMC; Methylmethcathinone | 2-(methylamino)-1- (3-methylphenyl)-1-propanone | 1246816-62-5 |

| 24 | 4-CEC; 4-chloroethcathinone | 1-(4-Chlorophenyl)-2-(ethylamino)-1-propanone | 14919-85-8 |

| 25 | 4-CMC; Clefedrone; 4-chloromethcathinone | 1-(4-chlorophenyl)-2-methylamine)propan-1-one | 1225843-86-6 |

| 26 | 4-MC; 4-methylcathinone; Normephedrone | 2-amino-1- (4-methylphenyl) propan-1-one | 31952-47-3 |

| 27 | 4-MEC; 4-methylethcathinone | 2-(ethylamino)-1- (4-methylphenyl) propan-1-one | 1225617-18-4 |

| 28 | 4-MMC; Mephedrone; 4-methylmethcathinone | (RS)-2-methylamino-1-(4-methylphenyl) propan-1-one | 1189805-46-6 |

| 29 | 3-Meo-PCP | 1-[1-(3-methoxyphenyl) cyclohexy]-piperidine | 72242-03-6 |

| 30 | 4,4’-DMAR; Para-methyl-4-methylaminorex | 4-Methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2- amine | 1445569-01-6 |

| 31 | 4-fluoroamphetamine, 4-FA | 1-(4-Fluorophenyl)-2-propanamine | 459-02-9 |

| 32 | 4F-ABUTINACA | 1-(4-fluorobutyl)-N-tricyclo[3.3.1.1.13,7] dec-1-yl-1H-indazole-3-carboxamide | 1445580-39-1 |

| 33 | 4F-MDMB-BICA; 4F-MDMB-BUTICA | Methyl 2-[1-(4-fluorobutyl)-1H-indole-3-carboxamido]-3,3-dimethylbutanoate | |

| 34 | 4F-MDMB-BINACA; 4F-MDMB-BUTINACA | Methyl (S) 2-(1-(4-fluorobutyl)-1H-indazole-3-carboxamido)-3,3-dimethylbutanoate | 2390036-46-9 |

| 35 | 4-MTA | α-methyl-4-methylthiophenethylamine | 14116-06-4 |

| 36 | 4-HO-DiPT | 3-[2-(diisoprapylamino) ethyl]-1 H -indol-4-oI | 63065-90-7 |

| 37 | 4-Hydroxy-3,3,4-trimethyl-1-(1-pentyl-1H-indol-3-yl) pentan-1-one | 4-hydroxy-3,3,4-trimethyl-1-(1-pentyl-1 H -indol-3-yl) pentan-1-one | 1445751-38-1 |

| 38 | 5-APB | 1-Benzofuran-5-ylpropan-2-amine | 286834-81-9 |

| 39 | 5C-AKB48 | N -(adamantan-1-yl)-1-(5-chloropentyl)-1 H -indazole-3-carboxamide | |

| 40 | 5-Chloro-NNE1; 5-C1-MN-24 | 1-(5-chloropentyl)- N -(naphthalen-1-yl)-1 H -indole-3-carboxamide | |

| 41 | 5-C1-AB-PINACA | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-chloropentyl)-1 H -indazole-3-carboxamide | 1801552-02-2 |

| 42 | 5F-AB-001 | adamantan-1-yl(1-(5-fluoropentyl)-1 H -indol-3-yl) methanone | |

| 43 | 5F-AB-FUPPYCA | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-5-(4-fluorophenyl)-1 H -pyrazole-3-carboxamide | |

| 44 | 5F-AB-PINACA | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-1 H -indazole-3-carboxamide | 1800101-60-3 |

| 45 | 5F-ADBICA | N -(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-1 H -indole-3-carboxamide | 1863065-82-0 |

| 46 | 5F-ADB-PINACA | N -(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-1 H -indazole-3-carboxamide | 1863065-90-0 |

| 47 | 5F-AEB | (S)-ethyl 2-(1-(5-fluoropentyl)-1H-indazole-3-carboxamido)-3-methylbutanoate | |

| 48 | 5F-AKB48; 5F-APINACA | N-(adamantan-1-yl)-1-(5-fluoropentyl)-1H-indazole-3-carboxamide | 1400742-13-3 |

| 49 | 5F-AMB; 5F-AMB-PINACA; 5F-MMB- PINACA | methyl 2-(1-(5-fluoropentyl)-1 H - indazole-3-carboxamido)-3- methylbutanoate | 1801552-03-3 |

| 50 | 5F-AMBICA | N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-1H-indole-3-carboxamide | 1801338-26-0 |

| 51 | 5F-APICA | N-(adamantan-1-yl)-1-(5-fluoropentyl)-1H-indole-3-carboxamide | 1354631-26-7 |

| 52 | 5F-APP-PICA; PX-1 | N-(1-amino-3-phenyl-1-oxopropan-2-yl)-1-(5-fluoropentyl)-1H-indole-3-carboxamide | |

| 53 | 5F-APP-PINACA | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-(5-fluoropentyl)-1H-indazole-3-carboxamide | |

| 54 | 5F-EMB-PINACA | Ethyl 2-(1-(5-fluoropentyl)-1H-indazole-3-carboxamido)- 3-methylbutanoate | |

| 55 | 5F-INPB-22 | quinolin-8-yl 1-(5-fluoropentyl)-1 H -indazole-3-carboxylate | |

| 56 | 5-fluoropentyl-3-pyridinoylindole | (1-(5-fluoropentyl)-1 H -indol-3-yl) (pyridin-3-yl) methanone | |

| 57 | 5F-MDMB-PICA; 5F-MDMB-2201; MDMB-2201 | Methyl(S)-2-(1-(5-fluoropentyl)-1H-indole-3- carboxamido)-3,3- dimethylbutanoate | 1971007-88-1 |

| 58 | 5F-MDMB-PINACA; 5F-ADB | Methyl(2S)-2-(1-(5-fluoropentyl)-1 H -indazole-3-carboxamido)-3,3-dimethylbutanoate | 1715016-75-3 |

| 59 | 5F-MMB-PICA | Methyl 2-([1-(5-fluoropentyl)-1H-indol-3-yl]carboxamido)-3-methylbutanoate | 1616253-26-9 |

| 60 | 5F-MN-18 | 1-(5-fluoropentyl)- N -(naphthalen-1-yl)-1 H -indazole-3-carboxamide | |

| 61 | 5F-MN-24 | 1-(5-fluoropentyl)- N -(naphthalen-1-yl)-1 H -indole-3-carboxamide | 1445580-60-8 |

| 62 | 5F-PB-22 | quinolin-8-yl 1-(5-fluoropentyl)-1 H -indole-3-carboxylate | 1400742-41-7 |

| 63 | 5F-PCN | 1-(5-fluoropentyl)- N -(naphthalen-1-yl)-1 H -pyrrolo[3,2-c]pyridine-3-carboxamide | |

| 64 | 5F-PY-PICA | (1-(5-fluoropentyl)-1 H -indol-3-yl)(pyrrolidin-1-yl)methanone | |

| 65 | 5F-PY-PINACA | (1-(5-fluoropentyl)-1 H -indazol-3-yl)(pyxrolidin-1-yl)methanone | |

| 66 | 5F-SDB-005 | naphthalen-1-yl 1-(5-fluoropentyl)-1 H -indazole-3-carboxylate | |

| 67 | 5F-SDB-006 | N -benzyl-1-(5-fluoropentyl)-1 H -indole-3-carboxamide | 776086-02-2 |

| 68 | 5F-THJ; 5F-THJ-018 | 1-(5-fluoropentyl)- N -(quinolin-8-yl)-1 H -indazole-3-carboxamide | |

| 69 | 5F-UR-144 indazole | (1-(5-fluoropentyl)-1 H -indazol-3-yl)(2,2,3,3tetramethylcyclopropyl) methanone | |

| 70 | 5-Meo-DiPT | 3- [2- (diisopropylamino) ethyl] -5- methoxyindole | 4021-34-5 |

| 71 | 5-MeO-MiPT | N - [2- (5-methoxy-1 H -indol-3-yl) ethyl] - N -methylpropan-2-amin | 96096-55-8 |

| 72 | 25B-NBOMe | 2- (4 - bromo - 2,5 -dimethoxyphenyl) - N [(2-methoxyphenyl) methyl] ethanamine | 1026511-90-9 |

| 73 | 25C-NBOMe | 2- (4-chloro-2,5-dimethoxyphenyl) - N - [(2-methoxyphenyl) methyl] ethanamine | 1227608-02-7 |

| 74 | 25I-NBOMe | 2- (4-iodo-2,5-dimethoxyphenyl) - N - [(2- methoxyphenyl) methyl] ethanamine | 919797-19-6 |

| 75 | A-796,260 | (1-(2-morpholinoethyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | 895155-26-7 |

| 76 | A-796,260 isomer | E)-3,4,4-trimethyl-1-(1-(2-morpholinoethyl)-1 H -indol-3-yl)pent-2-en-1-one | |

| 77 | A-834,735 | (1-((tetrahydro-2 H -pyran-4-yl)methyl)-1 H -indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone | 895155-57-4 |

| 78 | A-836,339 | (E)- N -(3-(2-methoxyethyl)-4,5-dimethylthiazol-2(3 H )-ylidene)-2,2,3,3-tetramethylcyclopropane-1-carboxamide | 959746-77-1 |

| 79 | AB-005 | (1-((1-methylpiperidin-2-yl)methyI)-1 H -indol-3-yl)(2,2,3,3-tetramethylcyclopropyl) methanone | 895155-25-6 |

| 80 | AB-005 azepane | (1-(1-methylazepan-3-yl)-1 H -indol-3-yl)(2,2,3,3-tetramethylcyclopropyl) methanone | |

| 81 | AB-CHMFUPPYCA | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(cyclohexylmethyl)-3-(4-fluorophenyl)-1 H -pyrazole-5-carboxamide | 1870799-79-3 |

| 82 | AB-CHMICA | (S)- N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(cyclohexylmethyl)-1 H -indole-3-carboxamide | |

| 83 | AB-CHMINACA | N -[2S]-1-amino-3-methyl-oxobutan-2-yl]-1-(cyclohexylmethyl)-1 H -indazole-3-carboxamide | 1185887-21-1 |

| 84 | AB-CHMINACA 2’- indazole | (S)- N -(1-amino-3-methyl-1-oxobutan-2-yl)-2-(cyclohexylmethyl)-2 H -indazole-3-carboxamide | |

| 85 | AB-FUBINACA | N-[(2S)-1-Amino-3-methyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3 -carboxamide | 1185282-01-2 |

| 86 | AB-FUBINACA 2- fluorobenzyl | (S)- N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(2-fluorobenzyl)-1 H -indazole-3-carboxamide | 1185282-16-9 |

| 87 | AB-PICA | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-pentyl-1 H -indole-3-carboxamide | |

| 88 | AB-PINACA | (S)- N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-pentyl-1 H -indazole-3-carboxamide | 1445752-09-9 |

| 89 | AB-PINACA N-(2-fluoropentyl) | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(2-fluoropentyl)-1 H -indazole-3-carboxamide | |

| 90 | AB-PINACA N-(3-fluoropentyl) | N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-(3-fluoropentyl)-1 H -indazole-3-carboxamide | |

| 91 | AB-PINACA N-(4-fluoropentyl) | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(4-fluoropentyl)-1 H -indazole-3-carboxamide | |

| 92 | AB-PINACA N-(5-fluoropentyl) | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-fluoropentyl)-1 H -indazole-3-carboxamide | |

| 93 | AB-PINACA-N-FluoroPentyl | N - (1-amino 3 methyl- 1- oxobutan- 2-yl) -1- fluoropentyl) -1 H - indazole-3 cacboxamide | |

| 94 | Acetylpsilocine; Psilacetine; 4-AcO DMT | 4-Acetoxy-N,N-dimethyl tryptamine, 3- (2'-dimethylaminoethyl)-4-acetoxy-indole | 92292-84-7 |

| 95 | Alpha-PHP; PV-7; α-pyrrolidinohexanophenone | 1-phenyl-2-(pyrrolidin-1-yl) hexan-1 -one | 13415-86-6 |

| 96 | Adamantyl-THPINACA | N -(adamantan-1-yl)-1-((tetrahydro-2 H -pyran-4-yl)methyl)-1 H -indazole-3-carboxamide | |

| 97 | ADB-BUTINACA | N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-butyl-1H-indazole-3-carboxamide | 2682867-55-4 |

| 98 | ADB-CHMICA | N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-(cyclohexylmethyl)-1 H -indole-3-carboxamide | |

| 99 | ADB-CHMINACA; MAB-CHMINACA | N -[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(cyclohexylmethyl)-1 H -indazole-3-carboxamide | 1185887-13-1 |

| 100 | ADB-FUBICA | (S)- N -(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-(4-fluorobenzyl)-1 H -indole-3-carboxamide | |

| 101 | ADB-FUBIATA | 2-(2-(1-(4-fluorobenzyl)-1H-indol-3-yl)acetamido)-3,3-dimethylbutanamide | |

| 102 | ADB-FUBINACA | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]-1H-indazole-3-carboxamide | 1445583-51-6 |

| 103 | ADBICA, ADB-PICA | N -(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-pentyl-1 H -indole-3-carboxamide | 1445583-48-1 |

| 104 | ADB-ICA | (S)-N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1H-indole-3-carboxamide | |

| 105 | ADB-INACA | N-[(1S)-1-(aminocarbonyl)-2,2-dimethylpropyl]-1H-indazole-3- carboxamide | 1887742-42-8 |

| 106 | ADB-4en-PINACA | N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-(pent-4-en-1-yl)-1H-indazoIe-3-carboxamide | 2659308-44-6 |

| 107 | ADB-PINACA | N -(1-amino-3,3-dimethyl-1-oxobutan-2-yl)-1-pentyl-1 H -indazole-3-carboxamide | 1633766-73-0 |

| 108 | ADSB-FUB-187 | 7-chloro- N -(1-((2-(cyclopropanesulfonamido) ethyl)amino)-3,3-dimethyl-1-oxobutan-2-yl)-1-(4-fluorobenzyl)-1 H -indazole-3-carboxamide | |

| 109 | AKB-57 | adamantan-1-yl 1-pentyl-1 H -indazole-3-carboxylate | |

| 110 | Alpha-PiHP | 4-Methyl-1-phenyl-2-(pyrrolidin-1-yl) pentan-1-one | 2181620-71-1 |

| 111 | α -Pyrrolidinopentiophenone; Alpha-PVP | ( RS )-1-Phenyl-2-(1-pyrrolidinyl)-1-pentanone | 14530-33-7 |

| 112 | AM-1220 | (1-((1-methylpiperidin-2-yl) methyl)-1 H -indol-3-yl)(naphthalen-1-yl)methanone | 137642-54-7 |

| 113 | AM-1220 azepane isomer | (1-[(1-methyl azepan-3-yl) methyl]-1 H -indol-3-yl)(naphthalen-1-yl)methanone | 1348081-04-8 |

| 114 | AM-1241 | (2-iodo-5-nitrophenyl)(1-((1-methylpiperidin-2-yl)methyl)-1 H -indol-3-yl)methanone | 444912-48-5 |

| 115 | AM-1248 | adamantan-1-yl(1-((1-methylpiperidin-2-yl)methyl)-1 H -indol-3-yl)methanone | 335160-66-2 |

| 116 | AM-1248 azepane isomer | (adamantan-1-yl)(1-(1-methylazepan-3-yl)-1 H -indol-3-yl)methanone | |

| 117 | AM-2201 | 1-[(5-fluoropentyl) -1 H -indole-3-yl] - (naphthalen-1-yl) methanone | 335161-24-5 |

| 118 | AM-2201 4-methoxynaphtyl | (1-(5-fluoropentyl)-1 H -indol-3-yl)(4-methoxynaphthalen-1-yl)methanone | |

| 119 | AM-2201 N-(4-fluoropentyl) | (1-(4-fluoropentyl)-1 H -indol-3-yl) (naphthalen-1-yl)methanone | |

| 120 | AM-2232 | 5-(3-(1-naphthoyl)-1 H -indol-1-yl) pentanenitrile | 335161-19-8 |

| 121 | AM-2233 | (2-iodophenyl)(1-((1-methylpiperidin-2-yl)methyl)-1 H -indol-3-yl)methanone | 444912-75-8 |

| 122 | AM-356 | (5Z,8Z,11Z,14Z)- N -((R)-1-hydroxypropan-2-yl)icosa-5,8,11,14-tetraenamide | 157182-49-5 |

| 123 | AM-6527 N-(5-fluoropentyl) | 1-(5-fluoropentyl)- N -(naphthalen-2-yl)-1 H -indole-3-carboxamide | |

| 124 | AM-679 | (2-iodophenyl)(1-pentyl-1 H -indol-3-yl) methanone | 335160-91-3 |

| 125 | AM-694 | (1-(5-fluoropentyl)-1 H -indol-3-yl)(2-iodophenyl)methanone | 335161-03-0 |

| 126 | AM-694 (Chloro) | (1-(5-chloropentyl)-1 H -indol-3-yl)(2-iodophenyl)methanone | |

| 127 | AMB; MMB-PINACA; AMB-PINACA | Methyl-3-methyl-2-(1-pentyl-1H-indazole-3-carboxamido) butanoate | 1890250-13-1 |

| 128 | AMB-CHMICA; MMB-CHMICA | Methyl 2-[1-(cyclohexylmethyl)-1H-indole-3-carboxamido]-3-methylbutanoate | |

| 129 | AMB-CHMINACA | Methyl 2-[1-(cyclohexylmethyl)-1H-indazole-3-carboxamidol-3-methylbutanoate | 1863066-03-8 |

| 130 | Amineptine | 7-[(10,11-dihydro-5H-dibenzo[a,d] cyclohepten5-yl) amino] heptanoic acid | 57574-09-1 |

| 131 | Amphetamine; Amfetamine | (±) - α - methylphenethylamine | 300-62-9 |

| 132 | APICA | N -(adamantan-1-yl)-1-pentyl-1 H -indole-3-carboxamide | 1345973-50-3 |

| 133 | APINACA; AKB48 | N -(adamantan-1-yl)-1-pentyl-1 H -indazole-3-carboxamide | 1345973-53-6 |

| 134 | APP-CHMINACA | N -(1-amino-1-oxo-3-phenylpropan-2-yl)-1-(cyclohexylmethyl)-1 H -indazole-3-carboxamide | 1185887-14-2 |

| 135 | Benzylone; BMDP | 1-(1,3-benzodioxol-5-yl)-2-(benzylamino) propan-1-one | 1823274-68-5 |

| 136 | BZP | 1-Benzylpiperazine | 2759-28-6 |

| 137 | Cannabipiperidiethanone | 2-(2-methoxyphenyl)-1-(1-((1-methylpiperidin-2-yl)methyl)-1 H- indol-3-yl)ethan-1-one | 1345970-43-5 |

| 138 | CBL-018 | naphthalen-1-yl 1-pentyl-1 H -indole-3-carboxylate | |

| 139 | CL-2201 | (4-chloronaphthalen-1 -yl)(1-(5-fluoropentyl)-1 H -indol-3 -yl)methanone | 1391486-12-6 |

| 140 | CP-47,497 | rel-2-((1R,3S)-3-hydroxycyclohexyl)-5-(2-methyloctan-2-yl) phenol | 70434-82-1 |

| 141 | CP-47.497-C6 | rel-2-((1R,3S)-3 -hydroxycyclohexyl)-5-(2-methylheptan-2-yl) phenol | 70435-06-2 |

| 142 | CP-47,497-C8 Cannabicyclohexanol | rel-2-((1R,3S)-3 -hydroxycyclohexyl)-5-(2-methylnonan-2-yl) phenol | 70434-92-3 |

| 143 | CP-47,497-C9 | rel-2-((1R,3S)-3-hydroxycyclohexyl)-5-(2-methyldecan-2-yl) phenol | 70435-08-4 |

| 144 | CP-55,244 | (2S,4S,4aS,6R,8aR)-4-(2-hydroxy-4-(2-methyloctan-2-yl) phenyl)-6-(hydroxymethyl) decahydronaphthalen-2-oI | |

| 145 | CP-55,940 | rel-2-((1R,2R,5R)-5-hydroxy-2-(3-hydroxypropyl) cyclohexyl)-5-(2-methyloctan-2-yl)phenol | 83003-12-7 |

| 146 | CRA-13 | naphthalen-1-yl(4-(pentyloxy) naphthalen-1-yl)methanone | 432047-72-8 |

| 147 | CUMYL-4CN-BINACA | 1-(4-cyanobutyl)- N -(1-methyl-1-phenyl-ethyl)indazole-3-carboxamide | 1631074-54-8 |

| 148 | CUMYL-5F-P7AICA | 1-(5-fluoropentyl)- N -(2-phenylpropan-2-yl)-1 H -pyrrolo[2,3-b] pyridine-3-carboxamide | |

| 149 | CUMYL-5F-PICA | 1-(5-fluoropentyl)- N -(2-phenylpropan-2-yl)-1 H -indole-3-carboxamide | |

| 150 | CUMYL-5F-PINACA | 1-(5-fluoropentyl)- N -(2-phenylpropan-2-yl)-1 H -indazole-3-carboxamide | 1400742-16-6 |

| 151 | CUMYL-BICA | 1-butyl- N -(2-phenylpropan-2-yl)-1 H -indole-3-carboxamide | |

| 152 | CUMYL PEGACLONE | 5-pentyl-2-(2-phenylpropan-2-yl)-2,5-dihydro-1H-pyrido[4,3-b] indol-1-one | 2160555-55-3 |

| 153 | CUMYL-PICA | 1-pentyl- N -(2-phenylpropan-2-yl)-1 H -indole-3-carboxamide | 1400742-32-6 |

| 154 | CUMYL-PINACA | 1-pentyl- N -(2-phenylpropan-2-yl)-1 H -indazole-3-carboxamide | 1400742-15-5 |

| 155 | CUMYL-THPINACA | N -(2-phenylpropan-2-yl)-1-((tetrahydro-2 H -pyran-4-yl) methyl)-1 H -indazole-3-carboxamide | 1400742-50-8 |

| 156 | Dexamphetamine | (+) - 2 - amino -1 - phenylpropane | 51-64-9 |

| 157 | Diethylpropion | 2-(Diethylamino) propiophenone | 90-84-6 |

| 158 | Dimethyl CP-47,497-C8 | rel-2-((1R,5S)-5-hydroxy-3,3-dimethyl cyclohexyl)-5-(2-methylnonan-2-yl) phenol | |

| 159 | Diphenidine | 1-(1,2-diphenylethyl) piperidine | 36794-52-2 |

| 160 | DOC; 2,5-Dimethoxy-4-chloroamphetamine | 1-(4-chloro-2,5-dimethoxy phenyl) propan-2-amine | 42203-77-0 |

| 161 | EAM-2201; 5F-JWH-210 | (4-ethylnaphthalen-1-yl)(1-(5-fluoropentyl)-1 H -indol-3-yl)methanone | 1364933-60-7 |

| 162 | EDMB-4en-PINACA | ethyl (S)-3,3-dimethyl-2-(1-(pent-4-en-1-yl)-1H-indazole-3-carboxamido) butanoate | |

| 163 | EG-018 | naphthalen-1-yl(9-pentyl-9 H -carbazol-3-yl) methanone | |

| 164 | EG-2201 | (9-(5-fluoropentyl)-9 H -carbazol-3-yl(naphthalen-1-yl)methanone | 3652-90-2 |

| 165 | EMB-FUBINACA | ethyl 2-(1-(4-fluorobenzyl)-1H-indazole-3-carboxamido)-3-methylbutanoate | |

| 166 | Ethylone | (RS) -1- (1,3-benzodioxol-5-yl) -2- (ethylamino) propane- 1-one | 1112937-64-0 |

| 167 | Ethylphenidate | (RS)-ethyl 2-phenyl-2-piperidin-2-yl acetate | 57413-43-1 |

| 168 | Etomidate | ethyl 3-[(1R)-1-phenylethyl] imidazole- 5- carboxylate | 33125-97-2 |

| 169 | Metomidate | methyl 3-(1-phenylethyl) imidazole-4-carboxylate | 5377-20-8 |

| 170 | Isopropoxate | isopropyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate | |

| 171 | Propoxate; Propomidate | propyl 3-(1-phenylethyl) imidazole-4-carboxylate | 7036-58-0 |

| 172 | Sec-butomidate | sec-butyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate | |

| 173 | Butomidate | butyl 1-(1-phenyIethyl)-1H-imidazole-5-carboxylate | 112367-53-0 |

| 174 | CF3-etomidate; TF-etomidate | trifluoroethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate | 2169968-54-9 |

| 175 | 4F-etomidate; Flutomidate | ethyl 1-(1-(4-fluorophenyl) ethyl)-1H-imidazole-5-carboxylate | 84962-75-4 |

| 176 | Eutylone; bk-EBDB; N-Ethylbutylone | 1-(1,3-benzodioxol-5-yl)-2-(ethylamino) butan-1-one | 802855-66-9 |

| 177 | FDU-NNEI | 1-(4-fluorobenzyl)- N -(naphthalen-1-yl)-1 H -indole-3-carboxamide | |

| 178 | FDU-PB-22 | naphthalen-1-yl 1-(4-fluorobenzyl)-1 H -indole-3-carboxylate | 1883282-94-3 |

| 179 | Fenethylline; Fenetylline | 7 - [2 - ( α - methylphenethyl - amino) ethyl] theophylline | 3736-08-1 |

| 180 | FUB-144; FUB-UR-144 | [1-(4-fluorobenzyl)-1 H -indol-3-yl] (2,2,3,3-tetramethylcyclopropyl)methanone | 2185863-15-2 |

| 181 | FUB-AKB-48 | N -((3s,5s,7s)-adamantan-1-yl)-1-(4-fluorobenzyl)-1 H -indazole-3-carboxamide | |

| 182 | FUB-AMB; AMB-FUBINACA; MMB-FUBINACA | Methyl 2-(1-(4-fluorobenzyl)-1H-indazole-3-carboxamido)-3-methylbutanoate | 1971007-92-7 |

| 183 | FUBIMINA | (1-(5-fluoropentyl)-1 H -benzo[d]imidazol-2-yl)(naphthalen-1-yl)methanone | 1984789-90-3 |

| 184 | FUB-JWH-018 | (1-(4-fluorobenzyl)-1 H -indol-3-yl)(naphthalen-1-yI)methanone | |

| 185 | FUB-PB-22 | quinolin-8-yl 1-(4-fluorobenzyl)-1 H -indole-3-carboxylate | 1800098-36-5 |

| 186 | GHB | γ -Hydroxybutyric acid | 591-81-1 |

| 187 | Hexahydrocannabinol; HHC và ester | 6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-1-ol | |

| 188 | HU-210 | (6aR,10aR)-9-(hydfoxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydro-6 H -benzo[c]chromen-1-ol | 112830-95-2 |

| 189 | HU-211 | (6aS,10aS)-9-(hydroxymethyl)-6,6-dinethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydro-6 H -benzo[c]chromen-1-ol | 112924-45-5 |

| 190 | HU-308 | (4-(2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl)-6,6-dimethylbicyclo [3.1.1]hept-2-en-2-yl) methanol | 256934-39-1 |

| 191 | HU-331 | (1'R)-6-hydroxy-3'-methyl-4-pentyl-6'-(prop-1-en-2-yl)-[1,1'-bi(cyclohexane)]-2',3,6-triene-2,5-dione | 137252-25-6 |

| 192 | INPB-22 | quinolin-8-yl 1-pentyl-1 H -indazole-3- carboxylate | 1445579-61-2 |

| 193 | JTE-907 | N -(benzo[d][1,3]dioxol-5-ylmethyl)-7-methoxy-2-oxo-8-(pentyloxy)-1,2-dihydroquinoline-3-carboxamide | 282089-49-0 |

| 194 | JWH-007 | (2-methyl-1-pentyl-1 H -indol-3-yl)(naphthalen-1-yl)methanone | 155471-10-6 |

| 195 | JWH-015 | (2-methyl-1-propyl-1 H -indol-3-yl) (naphthalen-1-yl)methanone | 155471-08-2 |

| 196 | JWH-018 | (1-pentyl-1H-indol-3-yl) (naphthalen-1-yl) methanone | 209414-07-3 |

| 197 | JWH-018 adamantyl; AB-001 | adamantan-1-yl(1-pentyl-1 H -indol-3-yl) methanone | 1345973-49-0 |

| 198 | JWH-018 cyclohexylmethyl | (1-(cyclohexylmethyl)-1 H -indol-3-yl) (naphthalen-1-yl)methanone | |

| 199 | JWH-018 isopentyl | (1-isopentyl-1 H -indol-3-yl)(naphthalen-1-yl)methanone | |

| 200 | JWH-018 N-(5-bromopentyl) | (1-(5-bromopentyl)-1 H -indol-3-yl)(naphthalen-1-yl)methanone | |

| 201 | JWH-018 N-(5-chloropentyl) | (1-(5-chloropentyl)-1 H -indol-3-yl)(naphthalen-1-yl)methanone | |

| 202 | JWH-018 N-(5-hydroxypentyl) | (1-(5-hydroxypentyl)-1 H -indol-3-yl)(naphthalen-1-yl)methanone | |

| 203 | JWH-019 | (1-hexyl-1 H -indol-3-yl)(naphthalen-1-yl) methanone | 209414-08-4 |

| 204 | JWH-022 | [1-(pent-4-en-1-yl)-1 H -indol-3-yl] (naphthalen-1-yl) methanone | 209414-16-4 |

| 205 | JWH-030 | naphthalen-1-yl(1-pentyl-1 H -pyrrol-3-yl)methanone | 162934-73-8 |

| 206 | JWH-071 | (1-ethyl-1 H -indol-3-yl)(naphthalen-1-yl)methanone | |

| 207 | JWH-073 | (1-butyl-1H-indol-3-yl)(naphthalen-1-yl)methanone | 208987-48-8 |

| 208 | JWH-073 4-methylnaphthyl | (1-butyl-1 H -indol-3-y1)(4-methylnaphthalen-1-yl)methanone | 1354631-21-2 |

| 209 | JWH-081 | (4-methoxynaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 210179-46-7 |

| 210 | JWH-122 | (4-methylnaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 619294-47-2 |

| 211 | JWH-122 5-Methyl-naphtyl | (5-methylnaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | |

| 212 | JWH-122 N-(4-pentenyl) | (4-methylnaphthalen-1-yl)(1-(pent-4-en-1-yl)-1 H -indol-3-yl)methanone | 1445577-68-3 |

| 213 | JWH-122 N-(4-pentenyl) -2- methylindole | (4-methylnaphthalen-1-yl)(1-(4-pentenyl) -2-methylindoIe)-1 H -indol-3-yl)methanone | |

| 214 | JWH-122 N-(5-chloropentyl) | (1-(5-chloropentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | 1445578-25-5 |

| 215 | JWH-122 N-(5-hydroxypentyl) | (1-(5-hydroxypentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | 1379604-68-8 |

| 216 | JWH-145 | naphthalen-1-yl(1-pentyl-5-phenyl-1 H -pyrrol-3-yl)methanone | 914458-19-8 |

| 217 | JWH-175 | 3-(naphthalen-1-ylmethy 1)-1-pentyl-1H-indole | 619294-35-8 |

| 218 | JWH-182 | (1-pentyl-1 H -indol-3-yl)(4-propylnaphthalen-1-yl)methanone | 824960-02-3 |

| 219 | JWH-200 | (1-(2-morpholinoethyl)-1 H -indol-3-yl)(naphthalen-1-yl)methanone | 103610-04-4 |

| 220 | JWH-201 | 2-(4-methoxyphenyl)-1-(1-pentyl-1 H -indol-3-yl)ethanone | 864445-47-6 |

| 221 | JWH-203 | 2-(2-chlorophenyl)-1-(1-pentyl-1 H -indol-3-yl)ethanone | 864445-54-5 |

| 222 | JWH-206 | 2-(4-chlorophenyl)-1-(1-pentyl-1 H -indol-3-yl)ethanone | 864445-58-9 |

| 223 | JWH-210 | (4-ethylnaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 824959-81-1 |

| 224 | JWH-213 | (4-ethylnaphthalen-1-yl)(2-methyl-1-pentyl-1 H -indol-3-yl)methanone | 824959-83-3 |

| 225 | JWH-250 | 2-(2-methoxyphenyl)-1-(1-Pentyl-1H-indol-3-yl)-ethanone | 864445-43-2 |

| 226 | JWH-251 | 2-(2-Methylphenyl)-1-(1-pentyl-1H-indol-3-yl)-ethanone | 864445-39-6 |

| 227 | JWH-267 | (2-methoxynaphthalen-1-yl)(1-pentyl-1H-indol-3-yl)methanone | |

| 228 | JWH-302 | 2-(3-methoxyphenyl)-1-(1-pentyl-1 H -indol-3-yl)ethanone | 864445-45-4 |

| 229 | JWH-307 | (5-(2-fluorophenyl)-1-pentyl-1 H -pyrrol-3-yl)(naphthalen-1-yl)methanone | 914458-26-7 |

| 230 | JWH-368 | (5-(3-fluoropheny 1)-1-pentyl-1 H -pyrrol-3-yl)(naphthalen-1-yl)methanone | 914458-31-4 |

| 231 | JWH-370 | [5-(2-methylphenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone | 914458-22-3 |

| 232 | JWH-387 | (4-bromonaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 1366067-59-5 |

| 233 | JWH-398 | (4-chloronaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 1292765-18-4 |

| 234 | JWH-412 | (4-fluoronaphthalen-1-yl)(1-pentyl-1 H -indol-3-yl)methanone | 1364933-59-4 |

| 235 | JWH-412 N-(-5-fluoropentyl) | (4-fluoronaphthalen-1-yl)(1-(5-fluoropentyl)-1 H -indol-3-yl)methanone | |

| 236 | Levamphetamine | (-)-(R)-α-methylphenethylamine | 156-34-3 |

| 237 | Levomethamphetamine; Levmetamfetamine | (-)-N,α - dimethylphenethylamine | 33817-09-3 |

| 238 | Lisdexamfetamine | (2S)-2,6-diamino-N-[(1S)-1- methyl-2-phenylethyl] hexanamide dimethanesulfonate | 608137-32-2 |

| 239 | LS-91297 | (4-methoxyphenyl)(1-methyl-1 H -indol-3-yl)methanone | |

| 240 | LTI-701 | 1-(5-fluoropentyl)- N -phenyl-1 H -indole-3-carboxamide | |

| 241 | LY-2183240 | 5-([1,1'-biphenyl]-4-yl methyl)- N,N -dimethyl-1 H -tetrazole-1-carboxamide | |

| 242 | LY2183240-2'-isomer | 5-([1,1'-biphenyl]-4-ylmethyl)- N,N -dimethyl-2 H -tetrazole-2-carboxamide | |

| 243 | M5FPIC | methyl 1-(5-fluoropentyl)-1 H -indole-3-carboxylate | |

| 244 | MAM-2201 | (1-(5-fluoropentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | 1354631-24-5 |

| 245 | MAM-2201 N-(2-Fluoropentyl) | (1-(2-fluoropentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | |

| 246 | MAM-2201 N-(3-Fluoropentyl) | (1-(3-fluoropentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | |

| 247 | MAM-2201 N-(4-Fluoropentyl) | (1-(4-fluoropentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | |

| 248 | MAM-2201 N-(4-hydroxypentyl) | (1-(4-hydroxypentyl)-1 H -indol-3-yl)(4-methylnaphthalen-1-yl)methanone | |

| 249 | M-CHMIC | methyl 1-(cyclohexylmethyl)-1 H -indole-3-carboxylate | |

| 250 | MCPP ( m CPP) | Meta - Chlorophenyl piperazine | 6640-24-0 |

| 251 | MDMB-BUTICA; MDMB-BICA | methyl (S)-2-(1-butyl-1H-mdole-3-carboxamido)-3,3-dimethylbutanoate | |

| 252 | MDMB-BUTINACA, MDMB-BINACA | methyl 2-(1-butyl-1H-indazole-3- carboxamido)-3,3-dimethylbutanoate | |

| 253 | MDMB-CHMCZCA | methyl 2-(9-(cyclohexylmethyl)-9 H -carbazole-3-carboxamido)-3,3-dimethylbutanoate | |

| 254 | MDMB-CHMICA | methyl 2-(1-(cyclohexylmethyl)-1H-indole-3-carboxamido)-3,3-dimethylbutanoate | 1863065-84-2 |

| 255 | MDMB-CHMINACA | methyl 2-(1-(cyclohexylmethyl)-1 H -indazole-3-carboxamido)-3,3-dimethylbutanoate | 1185888-32-7 |

| 256 | MDMB-FUBICA | Methyl 2-(1-(4-fluorobenzyl)-1 H -indol-3-carboxamido)-3,3-dimethylbutanoate | 1971007-91-6 |

| 257 | MDMB-FUBINACA | methyl 2-(1-(4-fluorobenzyl)-1 H -indazole-3-carboxamido)-3,3-dimethylbutanoate | 1971007-93-8 |

| 258 | MDMB-3en-BUTINACA | methyl (S)-2-(1-(but-3-en-1-yl)-1H-indazole-3-carboxamido)-3,3-dimethylbutanoate | 2741575-87-9 |

| 259 | MDMB-4en-PINACA | methyl (S)-3,3-dimethyl-2-(1-(pent-4-en-1-yl)-1H-indazole-3- carboxamido) butanoate | 2504100-70-1 |

| 260 | MDMB-5Me-INACA | methyl (S)-3,3-dimethyl-2-(5-methyl-1H-indazole-3-carboxamido) butanoate | |

| 261 | MDMB-ICA | N-(1H-indol-3-ylcarbonyl)-3-methyl-L-valine, methyl ester | |

| 262 | MDMB-INACA | Methyl (S)-2-(1H-indazole-3-carboxamido)-3,3-dimethyl butanoate | 2709672-58-0 |

| 263 | MDPBP | ( RS )-1-(3,4-methylenedioxyphenyl)-2-(1-pyrrolidinyl)-1-butanone | 784985-33-7 |

| 264 | MDPV | ( RS )-1-(benzo[d][1,3] dioxol-5-yl)-2-(pyrrolidin-1-yl)pentan-1-one | 687603-66-3 |

| 265 | Mecloqualone | 3 - ( o - chlorophenyl) - 2 - methyl - 4 - (3 H ) - quinazolinone | 340-57-8 |

| 266 | Mepirapim | (4-methylpiperazin-1-yl) (1-pentyl-1 H -indol-3-yl)methanone | |

| 267 | Methamphetamine; Metamfetamine | (+)-(S)- N - α -dimethylphenethyIamine | 537-46-2 |

| 268 | Methamphetamine racemate | (±) - N, α - dimethylphenethylamine | 7632-10-2 |

| 269 | Methaqualone | 2 - methyl - 3 - o - tolyl - 4 - (3 H ) - quinazolinone | 72-44-6 |

| 270 | Methoxetamine; MXE | (RS)-2-(3-methoxyphenyl)-2-(ethylamino)-cyclohexanone | 1239943-76-0 |

| 271 | Methylphenidate | Methyl - α - phenyl - 2 - piperidineacetate | 113-45-1 |

| 272 | Methylone; Beta-keto-MDMA | 3,4 - methylenedioxy - N - methylcathinone | 186028-79-5 |

| 273 | MMB-018; MMB-PICA; AMB-PICA | Methyl-3-methyl-2-(1-pentyl-1H-indole-3-carboxamido)butanoate | 1971007-97-2 |

| 274 | MMB-022; MMB-4en-PICA | Methyl 3 -methyl-2- {[1-(pent-4-en-1-yl)- 1H-indol-3-yl] formamido} butanoate | |

| 275 | MMB-FUBICA; AMB-FUBICA | Methyl 2-(1-(4-fluorobenzyl)-1H-indole-3-carboxamido)-3- methylbutanoate | 1971007-90-5 |

| 276 | MN-18 | N -(naphthalen-1-yl)-1-pentyl-1 H -indazole-3-carboxamide | |

| 277 | MN-24; AM-6527; NNE1 | N -(naphthalen-1-yl)-1-pentyl-1 H -indole-3-carboxamide | 1338925-11-3 |

| 278 | MO-CHMINACA | 1-methoxy-3,3-dimethyl-1-oxobutan-2-yl 1-(cyclohexylmethyl)-1 H -indazole-3-carboxylate | |

| 279 | MPA; Methiopropamine | 1- (thiophen-2-yl) -2- methylaminopropane | 801156-47-8 |

| 280 | N-(1-Amino-3-methyl-1-oxobutan-2-yl)-1- (phenylmethyl)-1H-indazole-3-carboxamide | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-benzyl-1 H -indazole-3 -carboxamide | |

| 281 | N-(1-Amino-3-methyl-loxobutan-2-yl)-1- (phenylmethyl)-1H-indole-3-carboxamide | N -(1-amino-3-methyl-1-oxobutan-2-yl)-1-benzyl-1 H -indole-3-carboxamide | |

| 282 | N-(2-Methoxyethyl)-N-(1-methylethyl)-2-(1-pentyl-1H-indol-3-yl)-4-thiazol-methanamine | N-(2-methoxyethyl)- N -((2-(1-pentyl-1 H -indol-3-yl) thiazol-4-yl) methyl) propan-2-amine | 1400742-45-1 |

| 283 | N-(6-Quinolinyl)-1-pentyl-1H-indazole-3-carboxamide | 1-pentyl- N -(quinolin-6-yl)-1 H -indazole-3-carboxamide | |

| 284 | N-(Naphthalen-1-yl)-1H-indazole-3-carboxamide | N -(naphthaIen-1-yl)-1 H -indazole-3-carboxamide | |

| 285 | N-(naphthalen-1-yl)-1-pentyl-1H-pyrrolo [2,3-b]pyridine-3-carboxamide | N -(naphthalen-1-yl)-1-pentyl-1 H -pyrrolo[2,3-b] pyridine-3-carboxamide | |

| 286 | N,N-Diethyl-2-(1-pentyl-1H-indol-3-yl)-4-thiazol-methanamine | N -ethyl- N -((2-(1-pentyl-1 H -indol-3-yl) thiazol-4-yl) methyl) ethanamine | 1400742-46-2 |

| 287 | Naphthalen-1-yl(1-(pent-4-enyl)-1H-pyrrolo[2,3-b] pyridin-3-yl)methanone | naphthalen-1-yl(1-(pent-4-en-1-yl)-1 H -pyrrolo[2,3-b] pyridin-3-yl) methanone | |

| 288 | Naphthalen-1-yl(1-(pentyl-1H-benzo[d] imidazol-2-yl) methanone | naphthalen-1-yl(1-pentyl-1 H -benzo[d]imidazol-2-yl) methanone | |

| 289 | Naphthalen-1-yl-(1-pentyl-1H-7-azaindol-3-yl) methanone | Naphthalen-1-yl-(1-pentyl-1 H -7-azaindol-3-yl) methanone | |

| 290 | Naphthalen-1-yl-1-benzyl-1H-indole-3-carboxylate | naphthalen-1-yl 1-benzyl-1 H -indole-3-carboxylate | |

| 291 | N-Ethylnorpentylone, Ephylone | 1-(2H-1,3-Benzodioxol-5-yl)-2-(ethylamino) pentan-1-one | 952016-47-6 |

| 292 | N-Ethylhexedrone, NEH, Hexen, Ethyl-Hex | 2-(Ethylamino)-1-phenyl-1-hexanone | 802857-66-5 |

| 293 | N-methyl ethylone | 1-(benzo[d][1,3] dioxol-5-yl)-2-(ethyl(methyl)amino)propan-1-one | |

| 294 | NM-2201 | naphthalen-1-yl 1-(5-fluoropentyl)-1 H -indole-3-carboxylate | |

| 295 | N,N-Dimethylpentylone; Dipentylone | 1-(benzo[d][1,3] dioxol-5-yl)-2-(dimethylamino)pentan-1-one | 803614-36-0 |

| 296 | NNEI 2’-indazole isomer | N -(naphthalen-1-yl)-2-pentyl-2 H -indazole-3-carboxamide | |

| 297 | ORG 27569 | 5-chloro-3-ethyl- N -(4-(piperidin-1-yl) phenethyl)-1 H -indole-2-carboxamide | 868273-06-7 |

| 298 | ORG 27759 | N -(4-(dimethylamino) phenethyl)-3-ethyl-5-fluoro-1 H -indole-2-carboxamide | 868273-09-0 |

| 299 | ORG 29647 | N -(1-benzylpyrrolidin-3-yl)-5-chloro-3-ethyl-1 H -indole-2-carboxamide | |

| 300 | PB-22, QUPIC | quinolin-8-yl 1-pentyl-1 H -indole-3-carboxylate | 1400742-17-7 |

| 301 | PB-22 N-(2-fluoropentyl) | quinolin-8-yl 1-(2-fluoropentyl)-1 H -indazole-3-carboxylate | |

| 302 | PB-22 N-(4-fluoropentyl) | quinolin-8-yl 1-(4-fluoropentyl)-1 H -indazole-3-carboxylate | |

| 303 | Pentedrone | (±)-2-(methylamino)-1-phenylpentan-1-one | 879722-57-3 |

| 304 | Phencyclidine | 1 -(1-phenylcyclohexyl) piperidine | 77-10-1 |

| 305 | Phenmetrazine | 3-methyl-2-phenylmorpholine | 134-49-6 |

| 306 | PMMA | Para -methoxy methamphetamine | 3398-68-3 |

| 307 | Pravadoline; WIN 48,098 | (4-methoxyphenyl)(2-methyl-1-(2-morpholinoethyl)-1 H -indol-3 -yl) methanone | 92623-83-1 |

| 308 | Propylphenidate, PPH | Propyl 2-phenyl-2-(piperidin-2-yl) acetate | 1071564-47-0 |

| 309 | QUCHIC; BB-22 | quinolin-8-yl 1-(cyclohexylmethyl)-1 H -indole-3-carboxylate | 1400742-42-8 |

| 310 | Quinolin-8-yl-1-benzyl-1 H -indazole-3-carboxylate | quinolin-8-yl 1-benzyl-1 H -indazole-3-carboxylate | |

| 311 | RCS-2 butyl | 1-butyl-2-(2-methoxyphenyl)-1 H -indole-3-carbaldehyde | 1345966-63-3 |

| 312 | RCS-3 | 2-(3-methoxyphenyl)-1-(1-pentyl-indol-3-yl) methanone | 1379922-51-6 |

| 313 | RCS-4 | (4-methoxyphenyl) (1-pentyl-1 H- indol-3-yl) methanone | 1345966-78-0 |

| 314 | RCS-4 butyl | (4-methoxyphenyl) (1-butyl-1 H -indol-3-yl) methanone | 1345966-77-9 |

| 315 | RCS-4 ortho isomer | (2-methoxyphenyl) (1-pentyl-1 H -indol-3-yl) methanone | 1345966-76-8 |

| 316 | RCS-8; SR-18; BTM-8 | 1-(1-(2-cyclohexylethyl)-1 H -indol-3-yl)-2-(2-methoxyphenyl) ethan-1-one | 1345970-42-4 |

| 317 | Rimonabant | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(piperidin-1-yl)-1 H -pyrazole-3-carboxamide | 168273-06-1 |

| 318 | SDB-005 | naphthalen-1-yl 1-pentyl-1 H -indazole-3-carboxylate | |

| 319 | SDB-006 | N -benzyl-1 pentyl-1 H -indole-3-carboxamide | 695213-59-3 |

| 320 | Secobarbital | 5 - ally - 5 - (1 - methylbutyl) barbituric acid | 76-73-3 |

| 321 | TFMPP | 1[3-(trifluoromethyl) phenyl] piperazine | 15532-75-9 |

| 322 | THJ-018 | naphthalen-1-yl(1-pentyl-1 H -indazol-3-yl) methanone | 1364933-55-0 |

| 323 | THJ-2201 | (1-(5-fluoropentyl)-1 H -indazol-3-yl)(naphthalen-1-yl) methanone | 1801552-01-1 |

| 324 | Trans-CP 47,497-C8 | 2-[(1S,3S)-3-hydroxycyclohexyl]-5-(2-methylnonan-2-yl)phenol | |

| 325 | UR-144; KM-X1 | (1-pentyl-1 H -indol-3-yl) (2,2,3,3 - tetramethylcyclopropyl) methanone | 1199943-44-6 |

| 326 | UR-144 N-(3-chloropentyl) | (1-(3-chloropentyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | |

| 327 | UR-144 N-(4-pentenyl) | (1-(pent-4-en-1-yl)-1 H -indol-3-yI) (2,2,3,3-tetramethylcyclopropyl) methanone | |

| 328 | UR-144 N-(5-bromopentyl) | (1-(5-bromopentyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | 1628690-26-5 |

| 329 | UR-144 N-(5-chlorophentyl) | (1-(5-chloropentyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | 1445577-42-3 |

| 330 | UR-144 N-heptyl | (1-heptyl-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl)methanone | 1616469-06-7 |

| 331 | URB447 | (4-amino-1-(4-chlorobenzyl)-2-methyl-5-phenyl-1 H -pyrrol-3-yl) (phenyl) methanone | |

| 332 | URB597 | (3'-carbamoyl-[1,1'-biphenyl]-3-yl)(cyclohexyl)carbamate | 546141-08-6 |

| 333 | URB-602 | cyclohexyl [1,1'-biphenyl]-3-yl carbamate | 565460-15-3 |

| 334 | URB754 | 6-methyl-2-(p-tolylamino)-4 H -benzo[d][1,3]oxazin-4-one | 86672-58-4 |

| 335 | WIN 55, 212-2 | [(3R)-2,3-dihydro-5-methyl-3-(4-morpholinylmethyl) pyrrolo[1,2,3-de]-1,4-benzoxazin-6-yl](naphthalen-1-yl) methanone | 131543-23-2 |

| 336 | XLR-11 | (1-(5-fuoropentyl)-1 H -indol-3-yl) (2,3,3,3-tetramethylcyclopropyl) methanone | 1364933-54-9 |

| 337 | XLR-11 N-(2-fluoropentyl) | (1-(2-fluoropentyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | |

| 338 | XLR-11 N-(3-fluoropentyl) | (1-(3-fluoropentyl)-1 H -indol-3-yl) (2,2,3,3- tetramethylcyclopropyl) methanone | |

| 339 | XLR-11 N-(4-fluoropentyl) | (1-(4-fluorapentyl)-1 H -indol-3-yl) (2,2,3,3-tetramethylcyclopropyl) methanone | |

| 340 | XLR-12 | (2,2,3,3 -tetramethylcyclopropyl) (1-(4,4,4-trifluorobutyl)-1 H -indol-3-yl) methanone | 895155-78-9 |

| 341 | Zipeprol | α -( α -methoxybenzyl) -4-( β - methoxyphenethyl)-1-piperazineethanol | 34758-83-3 |

DANH MỤC III

CÁC CHẤT MA TÚY ĐƯỢC SỬ DỤNG TRONG NGHIÊN CỨU, KIỂM NGHIỆM, GIÁM ĐỊNH, VÌ MỤC ĐÍCH QUỐC PHÒNG, AN NINH HOẶC TRONG LĨNH VỰC Y TẾ, THÚ Y THEO QUY ĐỊNH CỦA CƠ QUAN CÓ THẨM QUYỀN

Các chất hướng thần và muối, đồng phân, muối của đồng phân có thể tồn tại của các chất sau:

| STT | Tên chất | Tên khoa học | Mã thông tin CAS |

|||||

| 1 | Allobarbital | 5,5 - diallylbarbituric acid | 52-43-7 |

| 2 | Alprazolam | 8 - chloro -1 - methyl - 6 - phenyl - 4 H - s - triazolo [4,3 - a ] [1,4] - benzodiazepine | 289981-97-7 |

| 3 | Amfepramone; Diethylpropion | 2-(diethylamino) propiophenone | 134-80-5 |

| 4 | Aminorex | 2 - amino - 5 - phenyl - 2 - oxazoline | 2207-50-3 |

| 5 | Amobarbital | 5 - ethyl - 5 - isopentylbarbituric acid | 57-43-2 |

| 6 | Barbital | 5,5 - diethylbarbituric acid | 57-44-3 |

| 7 | Benzfetamine | N - benzyl - N - α - dimethylphenethylamine | 156-08-1 |

| 8 | Bromazepam | 7 - bromo -1,3 - dihydro - 5 - (2 - pyridyl) - 2 H - 1,4 - benzodiazepin- 2 -one | 1812-30-2 |

| 9 | Brotizolam | 2- bromo-4-(o-chlorophenyl)-9 methyl-6H- thieno(33-f)-s- triazolo[43- α] [1,4] diazepine | 57801-81-7 |

| 10 | Bromazolam | 8-bromo-1-methyl-6-phenyl-4H-benzo[f] [1,2,4]triazolo[4,3-a] [1,4]diazepine | 71368-80-4 |

| 11 | Buprenorphine | 21 - cyclopropyl 7 - α- [( S ) -1- hydroxy -1,2,2 trimethylpropyl] - 6,14 - endo -ethano -6,7,8,14 - tetrahydrooripavine | 52485-79-7 |

| 12 | Butalbital | 5 - allyl - 5 - isobutylbarbituric acid | 77-26-9 |

| 13 | Butobarbital | 5 - butyl - 5 - ethylbarbituric acid | 77-28-1 |

| 14 | Camazepam | 7 - chloro -1,3 - dihydro - 3 - hydroxy -1 - methyl - 5 - phenyl - 2 H - 1,4 benzodiazepin - 2 - one dimethylcarbamate (ester) | 36104-80-0 |

| 15 | Carisoprodol | [2-(carbamoyloxymethyl)-2-methylpentyl] N - propan-2-yl carbamat. | 78-44-4 |

| 16 | Cathine; (+) norpseudoephedrine | (+) - (R)- α - [( R ) -1 - aminoethyl] benzylalcohol | 492-39-7 |

| 17 | Chlordiazepoxide | 7 - chloro - 2 - (methylamino) - 5 - phenyl - 3H - 1,4 - benzodiazepine - 4 - oxide | 58-25-3 |

| 18 | Clobazam | 7 - chloro -1 - methyl - 5 - phenyl - 1 H- 1,5 - benzodiazepine - 2,4 (3 H, 5H) - dione | 22316-47-8 |

| 19 | Clonazepam | 5 - ( o - chlorophenyl) -1,3- nitro - 2H - 1,4- benzodiazepine - 2 - one | 1622-61-3 |

| 20 | Clonazolam | 6-(2-chlorophenyl)-1-methyl-8-nitro-4H- benzo[f][1,2,4] triazolo [4,3-a][1,4]diazepine | 33887-02-4 |

| 21 | Clorazepate | 7 - chloro - 2,3 - dihydro - 2 - oxo - 5 - phenyl - 1 H - 1,4 - benzodiazepine - 3 - carboxylic acid | 23887-31-2 |

| 22 | Clotiazepam | 5-(2-chlorophenyl) -7-ethyl-1,3-dihydro-1-methyl - 2H -thieno[23,e] -1-4 -diazepin - 2 -one | 33671-46-4 |

| 23 | Cloxazolam | 10 - chloro -11 b- ( o - chlorophenyl) - 2,3,7 ,11b - tetrahydro oxazolon - [3,2- d ][1,4] benzodiazepin - 6(5 H )-one | 24166-13-0 |

| 24 | Cyclobarbital | 5 - (1-cyclohexen-1-yl) -5-ethylbarbituric acid | 52-31-3 |

| 25 | Delorazepam | 7-chloro-5- ( o -chlorophenyl)-1 ,3-dihydro-2H- 1,4- benzodiazepin-2- one | 2894-67-9 |

| 26 | Diazepam | 7 - chloro - 1,3 - dihydro -1 - methyl - 5 - phenyl - 2 H - 1,4 - benzodiazepin -2 - one | 439-14-5 |

| 27 | Diclazepam | 7-chloro-5-(2-chlorophenyl)-1-methyl-1,3-dihydro- 2H-benzo[e][1,4]diazepin-2-one | 2894-68-0 |

| 28 | Estazolam | 8-chloro-6-phenyl-4 H - s -triazolo-[4,3- α ][1,4-benzodiazepin | 29975-16-4 |

| 29 | Ethchlorvynol | 1 - choloro-3 - ethyl - 1 - penten - 4yn - 3 - ol | 113-18-8 |

| 30 | Ethinamate | 1 - ethynylcyclohexanolcarbamate | 126-52-3 |

| 31 | Ethyl loflazepate | Ethyl -7-chloro-5-( o - fluorophenyl)-2-3-dihydro -2- oxo-1 H -1,4- benzodiazepin-3- carboxylate | 29177-84-2 |

| 32 | Etilamfetamine | N-ethyl - α - methylphenylethylamine | 457-87-4 |

| 33 | Etizolam | 4-(2-chlorophenyl)-2-ethyl-9-methyl-6H-thieno [3,2-f] [1,2,4]triazolo[43-a][1,4] diaziepine | 40054-69-1 |

| 34 | Fencamfamine | N -ethyl - 3 - phenyl - 2 - norbomanamine | 1209-98-9 |

| 35 | Fenproporex | (±) - 3 - [(α - methylphenylethyl) aminol propionitrile | 16397-28-7 |

| 36 | Flualprazolam | 8-chloro-6-(2-fluorophenyl)-1-methy-4H-[1,2,4] triazolo[4,3-a][1,4] benzodiazepine | 28910-91-0 |

| 37 | Flubromazolam | 8-bromo-6-(2-fluorophenyl)-1-methy-4H- benzo[f][1,2,4]triazolo[4,3-a][1,4]diazepine | 612526-40-6 |

| 38 | Fludiazepam | 7 - chloro - 5 - ( o - fluorofenyl) -1,3 - dihydro - 2 H - 1,4 - benzodiazepin - 2 - one | 3900-31-0 |

| 39 | Flunitrazepaxn | 5 - ( o - fluorophenyl) - 1,3 - dihydro -1 - methyl - 7 - nitro - 2H - 1,4 - benzodiazepin - 2 - one | 1622-62-4 |

| 40 | Flurazepam | 7-chloro-1-[2 -(diethylamino) ethyl] -5 -o- fluorophenyl) -1,3 -dihydro -2H -1,4 -benzodiazepin -2 -one | 17617-23-1 |

| 41 | Glutethimide | 2 - ethyl - 2 - phenylglutarimide | 77-21-4 : |

| 42 | Halazepam | 7 - chloro - 1,3 - dihydro - 5 - phenyl -1 - (2,2,2 - trifluoroethyl) - 2H - 1,4 - benzodiazepin - 2 - one | 23092-17-3 |

| 43 | Haloxazolam | 10- bromo-11 b- (o- fluorophenyl)- 2,3,7,11 b- tetrahydrooxazolo [3,2- d ][1,4] benzodiazepin-6-(5H)- one | 59128-97-1 |

| 44 | Ketamine | (±)-2-(2-Chlorophenyl)-2- methylaminocyclohexanone | 6740-88-1 |

| 45 | Ketazolam | 11 - chloro - 8 - 12 b - dihydro - 2,8 - dimethyl -12 b - phenyl - 4 H- [1,3] - oxazino [3,2 - d] [1,4] benzodiazepin - 4,7 (6H) - dione | 27223-35-4 |

| 46 | Lefetamine; SPA | (-) - N,N - dimethyl - 1,2 - diphenylethylamine | 7262-75-1 |

| 47 | Loprazolam | 6 - (o- chlorophenyl) -2,4 -dihydro - 2-[(4-methyl -1 - [piperazmyl) methylene] - 8 - nitro -1- H - imidazo - [1,2 - a ] [1,4] benzodiazepin-1 -one | 61197-73-7 |

| 48 | Lorazepam | 7 - chloro -5 - (o- chlorofenyl) - 1,3 - dihydro - 3 - hydroxy - 2 H - 1,4 - benzodiazepin - 2 - one | 846-49-1 |

| 49 | Lormetazepam | 7-chloro-5 -( o -chlorofenyl) -1,3-dihydro -3 hydroxy- 1-methyl-2 H -1,4-benzodiazepin-2 -one | 848-75-9 |

| 50 | Mazindol | 5 - ( p -chlorophenyl) - 2,5 dihydro - 3 H - imidazo - (2,1 - a) isoindol - 5 - ol | 22232-71-9 |

| 51 | Medazepam | 7 - chloro - 2,3 - dihydro - 1 - methyl - 5 - phenyl - 1 H - 1,4 - benzodiazepine | 2898-12-6 |

| 52 | Mefenorex | N- ( 3 - chloropropyl) - α - methylphenethylamine | 17243-57-1 |

| 53 | Meprobamate | 2-methyl-2-propyl -1,3 -propanediol dicarbamate | 57-53-4 |

| 54 | Mesocarb | 3 - (α - methylphenethyl) - N - (phenylcarbamoyl) syndnoneimine | 34262-84-5 |

| 55 | Methylphenobarbital | 5 - ethyl - 1 - methyl - 5 - phenylbarbituric acid | 115-38-8 |

| 56 | Methyprylon | 3,3 - diethyl - 5 - methyl - 2,4 - piperidine - dione | 125-64-4 |

| 57 | Midazolam | 8 - chloro - 6 - ( o - fluorophenyl) - 1 - methyl - 4 H - imidazo - [1,5 - a ] [1,4] - benzodiazepin | 59467-70-8 |

| 58 | Nimetazepam | 1,3 - dihydro -1 - methyl - 7 - nitro - 5 - phenyl - 2H - 1,4 - benzodiazepin - 2 - one | 2011-67-8 |

| 59 | Nitrazepam | 1,3 - dihydro - 7 - nitro - 5 phenyl - 2 H - 1,4 - benzodiazepin -2 - one | 146-22-5 |

| 60 | Nordazepam | 7-chloro-1,3-dihydro-5-phenyl-2 H -1,4 - benzodiazepin-2-one | 1088-11-5 |

| 61 | Oxazepam | 7-chloro 1,3-dihydro-3- hydroxy-5- phenyl- 2H -1,4- benzodiazepin-2-one | 604-75-1 |

| 62 | Oxazolam | 10 - chloro - 2,3,7,11 b - tetrahydro - 2 - methyl - 11 b - phenyloxazolo [3,2 - d ][1,4] benzodiazepin - 6(5 H ) - one | 24143-17-7 |

| 63 | Pemoline | 2 - amino - 5 - phenyl - 2 - oxazolin- 4 - one | 2152-34-3 |

| 64 | Pentazocine | (2R*,6R*,11R*)-1,2,3,4,5,6-hexahydro-6,1 - dimethyl - 3 - (3- methyl- 2 - butenyl)- 2,6- methano- 3 - benzazocin- 8 - ol | 359-83-1 |

| 65 | Pentobarbital | 5 - ethyl - 5 - (1 - methylbutyl) barbituric acid | 76-74-4 |

| 66 | Phenazepam | 7-Bromo-5- (2-clophenyl) -1,3-dihydro-2 H -1,4- benzodiazepine-2-one | 51753-57-2 |

| 67 | Phendimefrazine | (+) - 3,4 - dimethyl - 2 - phenylmorpholine | 634-03-7 |

| 68 | Phenobarbital | 5 - ethyl - 5 - phenylbarbituric acid | 50-06-6 |

| 69 | Phentermine | α, α - dimethylphenethylamine | 122-09-8 |

| 70 | Pinazepam | 7 - chloro -1,3 - dihydro - 5 - phenyl - 1 - (2 - propynyl) - 2 H - 1,4 - benzodiazepin - 2 - one | 52463-83-9 |

| 71 | Pipradrol | 1 - 1 - diphenyl - 1 - (2 - piperidyl) - methanol | 467-60-7 |

| 72 | Prazepam | 7 -chloro -1 -(cyclopropylmethyl) -1,3 -dihydro -5 - phenyl -2 H -1,4 -benzodiazepin -2 -one | 2955-38-6 |

| 73 | Pyrovalerone | 4’ - methyl - 2 - (1 - pyrrolidinyl) valerophenone | 3563-49-3 |

| 74 | Secbutabarbital | 5 - sec - butyl - 5 - ethylbarbituric acid | 125-40-6 |

| 75 | Temazepam | 7 - chloro -13 - dihydro - 3 - hydroxy -1 - methyl - 5 – phenyl - 2H - 1,4 - benzodiazepin - 2 - one | 846-50-4 |

| 76 | Telrazepam | 7 -chloro -5 -(1 -cyclohexen- 1-yl) -1,3 - dihydro -1 methyl - 2H -1,4 - benzodiazepin-2 - one | 10379-14-3 |

| 77 | Tiletamine | 2-(ethylamino)-2-thiophen-2-yl cyclohexan -1-one | 14176-49-9 ; |

| 78 | Triazolam | 8 - chloro - 6 - (o - chlorophenyl) -1 - methyl - 4 H - s - triazolo [4,3 - a] [1,4] benzodiazepine | 28911-01-5 |

| 79 | Vinylbital | 5 - (1 - methylbutyl) - 5 - vinylbarbituric acid | 2430-49-1 |

| 80 | Zolazepam | 4 - (2 - fluorophenyl) -1,3,8 - trimethyl -6H - pyrazolo [3,4-e] [1,4] diazepin - 7 -one | 31352-82-6 |

| 81 | Zolpidem | N, N, 6 - trimethyl - 2 - p - tolylimidazol [1,2 - a ] pyridine - 3 - acetamide | 82626-48-0 |

DANH MỤC IV

CÁC TIỀN CHẤT

IVA. Các tiền chất thiết yếu, tham gia vào cấu trúc chất ma túy, không có ứng dụng hợp pháp trong y học và đời sống xã hội, được sử dụng hạn chế trong nghiên cứu, kiểm nghiệm, giám định, vì mục đích quốc phòng, an ninh theo quy định đặc biệt của cơ quan có thẩm quyền

Các chất và muối, ester, đồng phân, muối của đồng phân có thể tồn tại của các chất sau:

| STT | Tên chất | Tên khoa học | Mã thông tin CAS | Mã số hàng hóa | Cơ quan quản lý |

|||||||

| 1 | 1-boc-4-AP; tert -Butyl 4-(phenylamino) piperidine-1 -carboxylate | 4-(phenylamino)-1 - piperidinecarboxylic acid, 1,1 dimethylethyl ester) | 125541-22-2 | 2933.39.90 | Bộ Công an |

| 2 | 1 -boc-4-piperidone; tert -Butyl 4-oxopiperidine-1- carboxylate | 1 -piperidinecarboxylic acid, 4-oxo, 1,1- dimethylethyl ester | 79099-07-3 | 2933.39.90 | Bộ Công an |

| 3 | P-2-P methyl glycidic acid (BMK glycidic acid) | 2-oxiranecarboxylic acid, 2-methyl-3-phenyl- | 25547-51-7 | 2918.99.00 | Bộ Công an |

| 4 | P-2-P methyl glycidic acid, methyl ester | Methyl 2-methyl-3-phenyl- 2-oxiranecarboxylate | 80532-66-7 | 2918.99.00 | Bộ Công an |

| 5 | P-2-P methyl glycidic acid, ethyl ester | Ethyl 2-methyl-3-phenyl-2- oxiranecarboxylate | 41232-97-7 | 2918.99.00 | Bộ Công an |

| 6 | P-2-P methyl glycidic acid, propyl ester | Propyl 2-methyl-3-phenyl- 2-oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 7 | P-2-P methyl glycidic acid, isopropyl ester | Isopropyl 2-methyl-3- phenyl-2- oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 8 | P-2-P methyl glycidic acid, butyl ester | Butyl 2-methyl-3-phenyl-2- oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 9 | P-2-P methyl glycidic acid, isobutyl ester | Isobutyl 2-methyl-3- phenyl-2- oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 10 | P-2-P methyl glycidic acid, sec-butyl ester | sec-butyl 2-methyl-3- phenyl-2- oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 11 | P-2-P methyl glycidic acid, tert -butyl ester | tert-butyl 2-methyl-3- phenyl-2- oxiranecarboxylate | | 2918.99.00 | Bộ Công an |

| 12 | 3,4-MDP-2P-methyl glycidate (PMK glycidate) | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, methyl ester | 13605-48-6 | 2932.99.90 | Bộ Công an |

| 13 | 3,4-MDP-2P-methyl glycidic acid (PMK glycidic acid) | 2-oxiranecarboxylic acid, 3-(1,3-benzo dioxol-5-yl)-2-methyl- | 2167189-50-4 | 2932.99.90 | Bộ Công an |

| 14 | 3,4-MDP-2-P methyl glycidic acid, ethyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, ethyl ester | 28578-16- | 2932.99.90 | Bộ Công an |

| 15 | 3,4-MDP-2-P methyl glycidic acid, propyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, propyl ester | | 2932.99.90 | Bộ Công an |

| 16 | 3,4-MDP-2-P methyl glycidic acid, isopropyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, isopropyl ester | | 2932.99.90 | Bộ Công an |

| 17 | 3,4-MDP-2-P methyl glycidic acid, butyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl, butyl ester | | 2932.99.90 | Bộ Công an |

| 18 | 3,4-MDP-2-P methyl glycidic acid, isobutyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl- | | 2932.99.90 | Bộ Công an |

| 19 | 3,4-MDP-2-P methyl glycidic acid, sec-butyl ester | 2-oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl- | | 2932.99.90 | Bộ Công an |

| 20 | 3,4-MDP-2-P methyl glycidic acid, tert -butyl ester | 2-oxiranecarboxylic acid, 3-(1,3 -benzodioxol-5-yl)-2-methyl- | | 2932.99.90 | Bộ Công an |

| 21 | 4-Anilino-N-phenethylpiperidine; ANPP | N-phenyl-1-(2-phenylethyI) piperidin-4-amine | 21409-26-7 | 2933.36.00 | Bộ Công an |

| 22 | 4-AP | N-Phenyl-4-piperidinamine | 23056-29-3 | 2933.39.90 | Bộ Công an |

| 23 | 4-Piperidone | piperidin-4-one | 41661-47-6 | 2933.39.90 | Bộ Công an |

| 24 | Alpha-phenylaceto acetamide, APAA | 3-oxo-2-phenylbutanamide | 4433-77-6 | 2924.29.90 | Bộ Công an |

| 25 | Alpha-bromo-(o-chlorophenyl)-cyclopentyl ketone | Alpha-bromo-(o-chlorophenyl)-cyclopentyl ketone | | 2914.79.00 | Bộ Công an |

| 26 | Hydroxylimine | 1-hydroxycyclopentyl -(o-chlorophenyl)-ketone-N-methylimine | 6740-87-0 | 2925.29.00 | Bộ Công an |

| 27 | Methyl alpha-phenyl acetoacetate; MAPA | Methyl 3-oxo-2-phenylbutanoate | 16648-44-5 | 2918.30.00 | Bộ Công an |

| 28 | Norephedrine; Phenylpropanolamine | (1R,2S)-2-amino-1-phenylpropan-1-ol | 14838-15-4 | 2939.44.00 | Bộ. Công an |

| 29 | Norfentanyl | N-phenyl-N-4-piperidinyl-propanamide | 1609-66-1 | 2933.39.90 | Bộ Công an |

| 30 | N -Phenethyl-4-piperidinone; NPP | 1- (2-Phenylethyl) piperidine-4-one | 39742-60-4 | 2933.39.90 | Bộ Công an |

| 31 | o-Chiorophenyl cyclopentyl ketone | 2-Chlorophenyl cyclopentyl ketone | 6740-85-8 | 2914.29.90 | Bộ Công an |

IVB. Các tiền chất thiết yếu, tham gia vào cấu trúc chất ma túy, có ứng dụng hợp pháp trong y học và đời sống xã hội

Các chất và muối, ester, đồng phân, muối của đồng phân có thể tồn tại của các chất sau:

| STT | Tên chất | Tên khoa học | Mã thông tin CAS | Mã số hàng hóa | Cơ quan quản lý |

|||||||

| 1 | 1,4-Butanediol; BD; BDO | Butane-1,4-diol | 110-63-4 | 2905.39.00 | Bộ Công Thương |

| 2 | 1-phenyl-2-propanone; P2P | 1-phenyl-2-propanone | 103-79-7 | 2914.31.00 | Bộ Công Thương |

| 3 | Acetic anhydride | Acetic oxide | 108-24-7 | 2915.24.00 | Bộ Công Thương |

| 4 | Alpha -phenyl acetoacetonitrile; APAAN | 3-oxo-2-phenylbutanenitrile | 4468-48-8 | 2926.40.00 | Bộ Công Thương |

| 5 | Anthranilic acid | 2 - Aminobenzoic acid | 118-92-3 | 2922.43.00 | Bộ Công Thương |

| 6 | Benzaldehyde | Benzaldehyde | 100-52-7 | 2912.21.00 | Bộ Công Thương Bộ NN&MT |

| 7 | Benzyl cyanide | 2-Phenylacetonenitrile | 140-29-4 | 2926.90.00 | Bộ Công Thương |

| 8 | Cyclopentyl bromide | Bromocyclopentane | 137-43-9 | 2903.89.00 | Bộ Công Thương |

| 9 | Cyclopentyl chloride | Chlorocyclopentane | 930-28-9 | 2903.89.00 | Bộ Công Thương |

| 10 | Cyclopentyl magnesium bromide | Cyclopentyl magnesium bromide | 33240-34-5 | 2903.89.00 | Bộ Công Thương |

| 11 | Ephedrine | [R-(R*,S*)]-α-[1-(methylamino)ethyl] - benzenemethanol | 299-42-3 | 2939.41.00 | Bộ Y tế Bộ NN&MT |

| 12 | Ergometrine | Ergoline-8-carboxamide,9,10-didehydro-N-(2-hydroxy-1-methylethyl)-6-methyl-,[8 β (S) | 60-79-7 | 2939.61.00 | Bộ Y tế |

| 13 | Ergotamine | Ergotaman-3’,6’,18’ - trione, 12’-hydroxy-2’-methyl-5’- (phenylmethyl)-,(5 a ) | 113-15-5 | 2939.62.00 | Bộ Y tế |

| 14 | Gamma -butyro lactone; GBL | Dihidrofuran-2(3 H )-one | 96-48-0 | 2932.20.90 | Bộ Công Thương |

| 15 | Isosafrole | 1,3-benzodioxole,5- (1-propenyl-) | 120-58-1 | 2932.91.00 | Bộ Công Thương |

| 16 | Lysergic acid | (8β)-9,10-didehydro-6 - methylergolin-8-carboxylic acid | 82-58-6 | 2939.63.00 | Bộ Công Thương |

| 17 | N-acetylanthranilic acid | Benzoic acid, 2-(acetylamino)- | 89-52-1 | 2924.23.00 | Bộ Công Thương |

| 18 | N-Ethylephedrine | (1R,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol | 7681-79-0 | 2939.42.00 | Bộ Y tế |

| 19 | N-Ethylpseudo ephedrine | (1S,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol | 258827-65-5 | 2939.49.00 | Bộ Y tế |

| 20 | N-Methylephedrine | (1R,2S)-2-(Dimethylamino)-1-phenyl-1-propanol | 552-79-4 | 2939.49.00 | Bộ Y tế |

| 21 | N-Methyl pseudoephedrine | (1S,2S)-2-(dimethylamino)-1-phenylpropan-1-ol | 51018-28-1 | 2939.49.00 | Bộ Y tế |

| 22 | o-Chlorobenzonitrile | 2-ChIorobenzonitrile | 873-32-5 | 2926.90.00 | Bộ Công Thương |

| 23 | o-Bromobenzonitrile | 2-BromobenzonitriIe | 2042-37-7 | 2926.90.00 | Bộ Công Thương |

| 24 | Phenyl acetic acid | Benzeneacetic acid | 103-82-2 | 2916.34.00 | Bộ Công Thương Bộ NN&MT |

| 25 | Piperidine | Cyclopentimine | 110-89-4 | 2933.32.00 | Bộ Công Thương |

| 26 | Piperonal | 1,3-benzodioxole-5-carboxaldehyde | 120-57-0 | 2932.93.00 | Bộ Công Thương Bộ NN&MT |

| 27 | Piperonyl methyl ketone | 3,4 - methylenedioxyphenyl- 2- propanone | 4676-39-5 | 2932.92.00 | Bộ Công Thương |

| 28 | Propiophenone | 1-phenyl-1-propanone | 93-55-0 | 2914.39.00 | Bộ Công Thương |

| 29 | Pseudoephedrine | ([S-(R*,R*)]-α-[1-(methylamino)ethyl]- benzenemethanol) | 90-82-4 | 2939.42.00 | Bộ Y tế |

| 30 | Safrole | 1,3-benzodioxole,5-(2-propenyl)- | 94-59-7 | 2932.94.00 | Bộ Công Thương |

IVC. Các tiền chất là hóa chất, dung môi, chất xúc tác dùng trong quá trình sản xuất chất ma túy.

| STT | Tên chất | Tên khoa học | Mã thông tin CAS | Mã số hàng hóa | Cơ quan quản lý |

|||||||

| 1 | Acetic acid | Ethanoic acid | 64-19-7 | 2915.21.00 | Bộ Công Thương, Bộ NN&MT |

| 2 | Acetone | 2-propanone | 67-64-1 | 2914.11.00 | Bộ Công Thương, Bộ NN&MT |

| 3 | Acetyl chloride | Acetyl chloride | 75-36-5 | 2915.90.90 | Bộ Công Thương, Bộ NN&MT |

| 4 | Ammonium formate | Ammonium formate | 540-69-2 | 2915.12.00 | Bộ Công Thương, Bộ NN&MT |

| 5 | Diethyl amine | N -ethylethanamine | 109-89-7 | 2921.19.00 | Bộ Công Thương |

| 6 | Ethyl ether | 1-1’-oxybis [ethane] | 60-29-7 | 2909.11.00 | Bộ Công Thương |

| 7 | Ethylene diacetate | 1,2-ethanediol diacetate | 111-55-7 | 2915.39.90 | Bộ Công Thương |

| 8 | Formamide | Methanamide | 75-12-7 | 2924.19.90 | Bộ Công Thương |

| 9 | Formic Acid | Methamoic Acid | 64-18-6 | 2915.11.00 | Bộ Công Thương Bộ NN&MT |

| 10 | Hydrochloric acid | Hydrochloric acid | 7647-01-0 | 2806.10.00 | Bộ Công Thương Bộ NN&MT |

| 11 | Methyl ethyl ketone, MEK | 2-Butanone | 78-93-3 | 2914.12.00 | Bộ Công Thương |

| 12 | Methylamine | Methanamine | 74-89-5 | 2921.11.00 | Bộ Công Thương |

| 13 | Nitroethane | Nitroethane | 79-24-3 | 2904.20.90 | Bộ Công Thương |

| 14 | Potassium permanganate | Potassium permanganate | 7722-64-7 | 2841.61.00 | Bộ Công Thương |

| 15 | Sulfuric acid | Sulfuric acid | 7664-93-9 | 2807.00.10 2807.00.90 | Bộ Công Thương, Bộ NN&MT |

| 16 | Tartaric acid và đồng phân | 2,3-Dihydroxy butanedioic acid | 526-83-0 87-69- 4133-37-9 | 2918.12.00 | Bộ Công Thương, Bộ NN&MT |

| 17 | Thionyl chloride | Thionyl chloride | 7719-09-7 | 2812.17.00 | Bộ Công Thương |

| 18 | Toluene | Methyl benzene | 108-88-3 | 2902.30.00 | Bộ Công Thương |

Ghi chú chung các danh mục

1. Mã số CAS

- Chất ma túy dạng nguyên liệu thực vật không có mã thông tin CAS, một số chất ma túy chưa có sẵn mã CAS ở thời điểm cập nhật danh mục.

- Mã CAS của các chất trong danh mục không phải là duy nhất. Mã CAS trong danh mục thường là dạng base hay dạng hỗn hợp racemic của chất. Bất kỳ dạng muối, ester, ether, đồng phân, muối của đồng phân của một chất trong danh mục nếu tồn tại, dù mã CAS không xuất hiện trong danh mục vẫn được coi là một chất bị kiểm soát.

2. Đồng phân

2.1. Khi một chất có các đồng phân lập thể (stereochemical) mà tên khoa học của chất hiển thị dạng hỗn hợp đối quang (±) (racemic):

a. Nếu cấu trúc hóa học của chất có một tâm bất đối (chiral centre) thì cả 2 dạng đồng phân đối quang (enationmers) R và S (+ hoặc -) và hỗn hợp RS-racemic (±) đều bị kiểm soát.

b. Nếu cấu trúc hóa học của chất có nhiều hơn một tâm bất đối thì tất cả các đồng phân phi đối quang (diastereoisomers) và các cặp đối quang (racemic) của chúng đều bị kiểm soát.

2.2. Khi một chất có các đồng phân lập thể, cấu trúc có một tâm bất đối mà tên khoa học của chất chỉ ghi một loại đồng phân đối quang cụ thể (R hoặc S, + hoặc -) thì dạng hỗn hợp RS-racemic (±) của chất đó cũng bị kiểm soát.

2.3. Khi một chất có các đồng phân lập thể, cấu trúc có nhiều hơn một tâm bất đối mà tên khoa học của chất chỉ ghi một loại đồng phân phi đối quang (diastereoisomers) cụ thể thì chỉ có đồng phân phi đối quang đó bị kiểm soát.

2.4. Khi một đồng phân đối quang bị kiểm soát thì hỗn hợp của đồng phân đối quang đó với đồng phân đối quang còn lại cũng bị kiểm soát.

[1] Trừ trường hợp ethyl este của acid béo iod hóa trong dầu hạt thuốc phiện mà không còn chứa chất ma túy từ thuốc phiện.

[2] Dextromethorphan và dextrorphan không phải là chất bị kiểm soát

[3] Dextromethorphan và dextrorphan không phải là chất bị kiểm soát

4 điều

Trích dẫn văn bản này

Quy định các danh mục chất ma túy và tiền chất (Công báo Chính phủ). Truy cập qua LawPlayer, https://lawplayer.com/vn/act/vn-vbpl-187050

Nguồn: Cơ sở dữ liệu quốc gia về văn bản pháp luật (vbpl.vn), Bộ Tư pháp Việt Nam. Official legal texts are excluded from copyright under Article 8 of the Law on Intellectual Property of Vietnam. 再發布須標示來源(Công báo 條款)。 文本層經 Hugging Face vietnamese-legal-documents 資料集(CC BY 4.0)取得,署名依 CC BY 4.0。

VN-OfficialText-IPLawExempt+CC-BY-4.0

本頁資料來源:vbpl.vn (Bộ Tư pháp)·整理提供:法律人 LawPlayer· lawplayer.com